Difference between revisions of "CPDQT-38"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(5'-met...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5754 PWY-5754] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
** 4-hydroxybenzoate biosynthesis I (eukaryotes)
+
** 3-(5'-methylthio)pentylmalate
 +
* inchi key:
 +
** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 248.293   
 
* Synonym(s):
 
* Synonym(s):
** p-hydroxybenzoate biosynthesis I (eukaryotes)
+
** 3-(5'-methylthio)pentylmalic acid
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''6''' reactions in the full pathway
+
* [[RXNQT-4171]]
* [[4-COUMARATE--COA-LIGASE-RXN]]
+
== Reaction(s) known to produce the compound ==
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [[RXN-18204]]
* [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.23-RXN 3.1.2.23-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN HYDROXYPHENYLPYRUVATE-REDUCTASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1118 RXN3O-1118]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN3O-1120 RXN3O-1120]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: common name=4-hydroxybenzoate biosynthesis I (eukaryotes)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178]
{{#set: common name=p-hydroxybenzoate biosynthesis I (eukaryotes)}}
+
{{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
{{#set: reaction found=2}}
+
{{#set: common name=3-(5'-methylthio)pentylmalate}}
{{#set: reaction not found=6}}
+
{{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}}
{{#set: completion rate=33.0}}
+
{{#set: molecular weight=248.293    }}
 +
{{#set: common name=3-(5'-methylthio)pentylmalic acid}}
 +
{{#set: consumed by=RXNQT-4171}}
 +
{{#set: reversible reaction associated=RXN-18204}}

Latest revision as of 20:48, 21 March 2018

Metabolite CPDQT-38

  • smiles:
    • CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(5'-methylthio)pentylmalate
  • inchi key:
    • InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
  • molecular weight:
    • 248.293
  • Synonym(s):
    • 3-(5'-methylthio)pentylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.