Difference between revisions of "CPDQT-38"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.6.4.4-RXN 1.6.4.4-RXN] == * direction: ** REVERSIBLE * common name: ** nucleoredoxin ** ORF * ec...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] == * smiles: ** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(5'-met...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.6.4.4-RXN 1.6.4.4-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-38 CPDQT-38] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
 
* common name:
 
* common name:
−
** nucleoredoxin
+
** 3-(5'-methylthio)pentylmalate
−
** ORF
+
* inchi key:
−
* ec number:
+
** InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
−
** [http://enzyme.expasy.org/EC/1.8.1.8 EC-1.8.1.8]
+
* molecular weight:
 +
** 248.293   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(5'-methylthio)pentylmalic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXNQT-4171]]
−
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[Protein-Dithiols]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[Protein-Disulfides]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NAD(P)+[c] '''+''' 1 a protein dithiol[c] '''<=>''' 1 H+[c] '''+''' 1 NAD(P)H[c] '''+''' 1 a protein disulfide[c]
+
* [[RXN-18204]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15704]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_475]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R03913 R03913]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237178 44237178]
−
** [http://www.genome.jp/dbget-bin/www_bget?R03914 R03914]
+
{{#set: smiles=CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: common name=3-(5'-methylthio)pentylmalate}}
−
{{#set: common name=nucleoredoxin}}
+
{{#set: inchi key=InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L}}
−
{{#set: common name=ORF}}
+
{{#set: molecular weight=248.293    }}
−
{{#set: ec number=EC-1.8.1.8}}
+
{{#set: common name=3-(5'-methylthio)pentylmalic acid}}
−
{{#set: gene associated=Tiso_gene_15704|Tiso_gene_475}}
+
{{#set: consumed by=RXNQT-4171}}
−
{{#set: in pathway=}}
+
{{#set: reversible reaction associated=RXN-18204}}
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 20:48, 21 March 2018

Metabolite CPDQT-38

  • smiles:
    • CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(5'-methylthio)pentylmalate
  • inchi key:
    • InChIKey=YBISUHXEJDGADQ-UHFFFAOYSA-L
  • molecular weight:
    • 248.293
  • Synonym(s):
    • 3-(5'-methylthio)pentylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPDQT-38&oldid=43826"