Difference between revisions of "CYCLOARTENOL-SYNTHASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_2226 == * left end position: ** 7421 * transcription direction: ** NEGATIVE * right end position: ** 11435 * centisome position: ** 36.9774...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2226 == |
− | * | + | * left end position: |
− | ** | + | ** 7421 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 11435 |
− | * | + | * centisome position: |
− | ** | + | ** 36.97743 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[RXN-15556]] | |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | * [[ | + | ** [[pantograph]]-[[esiliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7421}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=11435}} | |
− | + | {{#set: centisome position=36.97743 }} | |
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 18:32, 10 January 2018
Gene Tiso_gene_2226
- left end position:
- 7421
- transcription direction:
- NEGATIVE
- right end position:
- 11435
- centisome position:
- 36.97743
- Synonym(s):
Reactions associated
- RXN-15556
- in-silico_annotation
- ec-number
- in-silico_annotation
- UBIQUITIN--PROTEIN-LIGASE-RXN
- in-silico_annotation
- ec-number
- pantograph-esiliculosus
- in-silico_annotation