Difference between revisions of "CYCLOHEXANOL-OXIDATION-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_2152 == * left end position: ** 241 * transcription direction: ** POSITIVE * right end position: ** 2289 * centisome position: ** 1.1807938...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] == * smiles: ** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_2152 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCEROL-P INDOLE-3-GLYCEROL-P] ==
−
* left end position:
+
* smiles:
−
** 241
+
** C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
−
* right end position:
+
* common name:
−
** 2289
+
** (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
−
* centisome position:
+
* molecular weight:
−
** 1.1807938    
+
** 285.193    
 
* Synonym(s):
 
* Synonym(s):
 +
** C1-(3-Indolyl)-glycerol 3-phosphate
 +
** indole-3-glycerol-P
 +
** 1-(indol-3-yl)glycerol-3-P
 +
** 1-(indol-3-yl)glycerol-3-phosphate
 +
** indoleglycerol phosphate
 +
** indole-3-glycerol-phosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[2.7.11.24-RXN]]
+
* [[TRYPSYN-RXN]]
−
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[IGPSYN-RXN]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 +
* [[RXN0-2381]]
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=241}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878464 46878464]
−
{{#set: right end position=2289}}
+
* CHEBI:
−
{{#set: centisome position=1.1807938   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58866 58866]
−
{{#set: reaction associated=2.7.11.24-RXN}}
+
* BIGG : 3ig3p
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03506 C03506]
 +
{{#set: smiles=C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)}}
 +
{{#set: inchi key=InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L}}
 +
{{#set: common name=(1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate}}
 +
{{#set: molecular weight=285.193   }}
 +
{{#set: common name=C1-(3-Indolyl)-glycerol 3-phosphate|indole-3-glycerol-P|1-(indol-3-yl)glycerol-3-P|1-(indol-3-yl)glycerol-3-phosphate|indoleglycerol phosphate|indole-3-glycerol-phosphate}}
 +
{{#set: consumed by=TRYPSYN-RXN}}
 +
{{#set: produced by=IGPSYN-RXN}}
 +
{{#set: consumed or produced by=RXN0-2381}}

Revision as of 16:44, 10 January 2018

Metabolite INDOLE-3-GLYCEROL-P

  • smiles:
    • C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)
  • inchi key:
    • InChIKey=NQEQTYPJSIEPHW-MNOVXSKESA-L
  • common name:
    • (1S,2R)-1-C-(indol-3-yl)glycerol 3-phosphate
  • molecular weight:
    • 285.193
  • Synonym(s):
    • C1-(3-Indolyl)-glycerol 3-phosphate
    • indole-3-glycerol-P
    • 1-(indol-3-yl)glycerol-3-P
    • 1-(indol-3-yl)glycerol-3-phosphate
    • indoleglycerol phosphate
    • indole-3-glycerol-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C2(=C(C1(C=CC=CC=1N2))C(C(COP([O-])(=O)[O-])O)O)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CYCLOHEXANOL-OXIDATION-PWY&oldid=10174"