Difference between revisions of "ENTDB-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GALACTOSE-1P GALACTOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi ke...") |
(Created page with "Category:Gene == Gene Tiso_gene_4277 == * left end position: ** 8211 * transcription direction: ** NEGATIVE * right end position: ** 13853 * centisome position: ** 47.5366...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_4277 == |
− | * | + | * left end position: |
− | ** | + | ** 8211 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 13853 |
− | * | + | * centisome position: |
− | ** | + | ** 47.536617 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.4.21.53-RXN]] | |
− | + | ** experimental_annotation | |
− | * [[ | + | ***automated-name-match |
− | * | + | == Pathways associated == |
− | * | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=8211}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=13853}} | |
− | + | {{#set: centisome position=47.536617 }} | |
− | + | {{#set: reaction associated=3.4.21.53-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 17:42, 10 January 2018
Gene Tiso_gene_4277
- left end position:
- 8211
- transcription direction:
- NEGATIVE
- right end position:
- 13853
- centisome position:
- 47.536617
- Synonym(s):
Reactions associated
- 3.4.21.53-RXN
- experimental_annotation
- automated-name-match
- experimental_annotation