Difference between revisions of "ExchangeSeed IODINE-MOLECULE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_IODINE-MOLECULE ExchangeSeed_IODINE-MOLECULE] == * direction: ** REVERSIBLE * Synonym(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4702 CPD-4702] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_IODINE-MOLECULE ExchangeSeed_IODINE-MOLECULE] ==
* smiles:
+
* direction:
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M
+
* common name:
+
** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
+
* molecular weight:
+
** 427.646   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-318]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[IODINE-MOLECULE]][C-BOUNDARY] '''<=>''' 1.0 [[IODINE-MOLECULE]][e]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 I2[C-BOUNDARY] '''<=>''' 1.0 I2[e]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from boundary to extracellular compartment]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659076 90659076]
+
{{#set: in pathway=}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(C([O-])=O)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: reconstruction category=manual}}
{{#set: inchi key=InChIKey=JHIWIFRQJXLNEU-GSQAGGHASA-M}}
+
{{#set: reconstruction source=manual-import_from_medium}}
{{#set: common name=4&alpha;-carboxy-5&alpha;-cholesta-8,24-dien-3&beta;-ol}}
+
{{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}}
{{#set: molecular weight=427.646    }}
+
{{#set: consumed by=RXN66-318}}
+

Latest revision as of 20:55, 21 March 2018

Reaction ExchangeSeed_IODINE-MOLECULE

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

Reconstruction information

External links