Difference between revisions of "ExchangeSeed WATER"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_WATER ExchangeSeed_WATER] == * direction: ** REVERSIBLE * Synonym(s): == Reaction For...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ExchangeSeed_WATER ExchangeSeed_WATER] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [ | + | ** 1.0 [[WATER]][C-BOUNDARY] '''<=>''' 1.0 [[WATER]][e] |
− | == | + | * With common name(s): |
− | == | + | ** 1.0 H2O[C-BOUNDARY] '''<=>''' 1.0 H2O[e] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-import_from_medium]] | ||
+ | *** Comment: [[added to manage seeds from boundary to extracellular compartment]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=manual}} | |
− | + | {{#set: reconstruction source=manual-import_from_medium}} | |
− | {{#set: | + | {{#set: reconstruction comment=added to manage seeds from boundary to extracellular compartment}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:16, 21 March 2018
Contents
Reaction ExchangeSeed_WATER
- direction:
- REVERSIBLE
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 H2O[C-BOUNDARY] <=> 1.0 H2O[e]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: manual