Difference between revisions of "GLUCOSE1PMETAB-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * common name: ** 3-keto-β-D-...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
− | ** | + | ** glucose and glucose-1-phosphate degradation |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''5''' reactions in the full pathway | |
− | * [[ | + | * [[GLUCOKIN-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_3107]] | ||
+ | *** [[Tiso_gene_1303]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[GLUCONOLACT-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_1947]] | ||
+ | *** [[Tiso_gene_15098]] | ||
+ | *** [[Tiso_gene_1948]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[PHOSPHOGLUCMUT-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_4816]] | ||
+ | *** [[Tiso_gene_13477]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE-1-PHOSPHAT-RXN GLUCOSE-1-PHOSPHAT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6373 RXN0-6373] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUCOSE1PMETAB-PWY GLUCOSE1PMETAB-PWY] |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=glucose and glucose-1-phosphate degradation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=60.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:04, 21 March 2018
Pathway GLUCOSE1PMETAB-PWY
- taxonomic range:
- common name:
- glucose and glucose-1-phosphate degradation
- Synonym(s):
Reaction(s) found
3 reactions found over 5 reactions in the full pathway
- GLUCOKIN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- GLUCONOLACT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- PHOSPHOGLUCMUT-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: