Difference between revisions of "GLUDEG-II-PWY"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5526 == * Synonym(s): == Reactions associated == * ATPASE-RXN ** in-silico_annotation ***ec-number == Pathways associated == == Extern...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9038 CPD-9038] == * smiles: ** CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9038 CPD-9038] == |
+ | * smiles: | ||
+ | ** CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=CJLVUWULFKHGFB-NZCAJUPMSA-F | ||
+ | * common name: | ||
+ | ** precorrin-1 | ||
+ | * molecular weight: | ||
+ | ** 842.768 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-8675]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[UROPORIIIMETHYLTRANSA-RXN]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245954 25245954] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58893 58893] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15527 C15527] | ||
+ | {{#set: smiles=CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O)}} | ||
+ | {{#set: inchi key=InChIKey=CJLVUWULFKHGFB-NZCAJUPMSA-F}} | ||
+ | {{#set: common name=precorrin-1}} | ||
+ | {{#set: molecular weight=842.768 }} | ||
+ | {{#set: consumed by=RXN-8675}} | ||
+ | {{#set: produced by=UROPORIIIMETHYLTRANSA-RXN}} |
Revision as of 19:01, 18 March 2018
Contents
Metabolite CPD-9038
- smiles:
- CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O)
- inchi key:
- InChIKey=CJLVUWULFKHGFB-NZCAJUPMSA-F
- common name:
- precorrin-1
- molecular weight:
- 842.768
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC3(C4(=CC5(=C(C(CCC([O-])=O)=C(CC1(=C(CCC([O-])=O)C(CC(=O)[O-])=C(N1)CC2(NC(=C(CC([O-])=O)C=2CCC([O-])=O)CC(C3CCC(=O)[O-])=N4)))N5)CC([O-])=O)))(CC([O-])=O)" cannot be used as a page name in this wiki.