Difference between revisions of "GLUTDEG-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUTDEG-PWY GLUTDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=GLUTDEG-PWY GLUTDEG-PWY] ==
* smiles:
+
* taxonomic range:
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
+
 
* common name:
 
* common name:
** L-thyroxine acyl β-D-glucuronide
+
** L-glutamate degradation II
* molecular weight:
+
** 951.992   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** L-aspartate degradation
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[RXN-10608]]
+
* [[ASPAMINOTRANS-RXN]]
== Reaction(s) of unknown directionality ==
+
** 6 associated gene(s):
 +
*** [[Tiso_gene_17718]]
 +
*** [[Tiso_gene_6815]]
 +
*** [[Tiso_gene_13538]]
 +
*** [[Tiso_gene_15680]]
 +
*** [[Tiso_gene_17809]]
 +
*** [[Tiso_gene_12889]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ASPARTASE-RXN ASPARTASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657991 90657991]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=GLUTDEG-PWY GLUTDEG-PWY]
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: inchi key=InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M}}
+
{{#set: common name=L-glutamate degradation II}}
{{#set: common name=L-thyroxine acyl β-D-glucuronide}}
+
{{#set: common name=L-aspartate degradation}}
{{#set: molecular weight=951.992    }}
+
{{#set: reaction found=1}}
{{#set: produced by=RXN-10608}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 20:06, 21 March 2018

Pathway GLUTDEG-PWY

  • taxonomic range:
  • common name:
    • L-glutamate degradation II
  • Synonym(s):
    • L-aspartate degradation

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links