Difference between revisions of "HACD5m"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DOPACHROME L-DOPACHROME] == * smiles: ** C([O-])(=O)C1(NC2(C(C1)=CC(=O)C(=O)C=2)) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5m HACD5m] == * direction: ** REVERSIBLE * common name: ** 3-hydroxyacyl-CoA dehydrogenase (C12...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HACD5m HACD5m] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxyacyl-CoA dehydrogenase (C12:0) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1.0 [[NADH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[CPD0-2105]][m] '''<=>''' 1.0 [[CPD0-2107]][m] '''+''' 1.0 [[NAD]][m] |
| − | * [[ | + | * With common name(s): |
| − | == | + | ** 1.0 NADH[m] '''+''' 1.0 H+[m] '''+''' 1.0 3-oxododecanoyl-CoA[m] '''<=>''' 1.0 (S)-3-hydroxydodecanoyl-CoA[m] '''+''' 1.0 NAD+[m] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_5857]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=3-hydroxyacyl-CoA dehydrogenase (C12:0)}} | |
| − | + | {{#set: gene associated=Tiso_gene_5857}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:13, 21 March 2018
Contents
Reaction HACD5m
- direction:
- REVERSIBLE
- common name:
- 3-hydroxyacyl-CoA dehydrogenase (C12:0)
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 NADH[m] + 1.0 H+[m] + 1.0 3-oxododecanoyl-CoA[m] <=> 1.0 (S)-3-hydroxydodecanoyl-CoA[m] + 1.0 NAD+[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5857
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
