Difference between revisions of "HOMOCYSDEGR-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
−
** InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783]
 
* common name:
 
* common name:
−
** phytenal
+
** reductive TCA cycle I
−
* molecular weight:
+
−
** 294.52   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2E-phytenal
+
** reductive tricarboxylic acid cycle
−
** 3,7,11,15-tetramethyl-2E-hexadecenal
+
** reductive tricarboxylic acid pathway
 +
** reductive citric acid cycle
 +
** reverse citric acid cycle
 +
** carbon fixation
 +
** CO2 fixation
 +
** reductive carboxylic acid cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN66-479]]
+
* '''7''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[ISOCITDEH-RXN]]
−
* [[RXN66-478]]
+
** [[PEPSYNTH-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** [[ACONITATEDEHYDR-RXN]]
 +
** [[ACONITATEHYDR-RXN]]
 +
** [[MALATE-DEH-RXN]]
 +
** [[SUCCCOASYN-RXN]]
 +
** [[FUMHYDR-RXN]]
 +
== Reaction(s) not found ==
 +
* '''5''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOX-RXN PEPCARBOX-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=ATP-CITRATE-PRO-S--LYASE-RXN ATP-CITRATE-PRO-S--LYASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104010025
+
{{#set: taxonomic range=TAX-3052}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9900764 9900764]
+
{{#set: taxonomic range=TAX-2157}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O}}
+
{{#set: taxonomic range=TAX-68336}}
−
{{#set: inchi key=InChIKey=RAFZYSUICBQABU-PYDDKJGSSA-N}}
+
{{#set: taxonomic range=TAX-200783}}
−
{{#set: common name=phytenal}}
+
{{#set: common name=reductive TCA cycle I}}
−
{{#set: molecular weight=294.52    }}
+
{{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}}
−
{{#set: common name=2E-phytenal|3,7,11,15-tetramethyl-2E-hexadecenal}}
+
{{#set: reaction found=7}}
−
{{#set: consumed by=RXN66-479}}
+
{{#set: reaction not found=5}}
−
{{#set: produced by=RXN66-478}}
+

Revision as of 17:18, 10 January 2018

Pathway P23-PWY

  • taxonomic range:
  • common name:
    • reductive TCA cycle I
  • Synonym(s):
    • reductive tricarboxylic acid cycle
    • reductive tricarboxylic acid pathway
    • reductive citric acid cycle
    • reverse citric acid cycle
    • carbon fixation
    • CO2 fixation
    • reductive carboxylic acid cycle

Reaction(s) found

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=HOMOCYSDEGR-PWY&oldid=12321"