Difference between revisions of "HOMOCYSDEGR-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P23-PWY P23-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3052 TAX-3052] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-68336 TAX-68336] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-200783 TAX-200783] | ||
* common name: | * common name: | ||
− | ** | + | ** reductive TCA cycle I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** reductive tricarboxylic acid cycle |
− | ** | + | ** reductive tricarboxylic acid pathway |
+ | ** reductive citric acid cycle | ||
+ | ** reverse citric acid cycle | ||
+ | ** carbon fixation | ||
+ | ** CO2 fixation | ||
+ | ** reductive carboxylic acid cycle | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | * '''7''' reaction(s) found |
− | == Reaction(s) | + | ** [[ISOCITDEH-RXN]] |
− | * [[ | + | ** [[PEPSYNTH-RXN]] |
− | == | + | ** [[ACONITATEDEHYDR-RXN]] |
+ | ** [[ACONITATEHYDR-RXN]] | ||
+ | ** [[MALATE-DEH-RXN]] | ||
+ | ** [[SUCCCOASYN-RXN]] | ||
+ | ** [[FUMHYDR-RXN]] | ||
+ | == Reaction(s) not found == | ||
+ | * '''5''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=PEPCARBOX-RXN PEPCARBOX-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=ATP-CITRATE-PRO-S--LYASE-RXN ATP-CITRATE-PRO-S--LYASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3052}} | |
− | + | {{#set: taxonomic range=TAX-1224}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | {{#set: | + | {{#set: taxonomic range=TAX-68336}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-200783}} |
− | {{#set: | + | {{#set: common name=reductive TCA cycle I}} |
− | {{#set: | + | {{#set: common name=reductive tricarboxylic acid cycle|reductive tricarboxylic acid pathway|reductive citric acid cycle|reverse citric acid cycle|carbon fixation|CO2 fixation|reductive carboxylic acid cycle}} |
− | {{#set: common name= | + | {{#set: reaction found=7}} |
− | {{#set: | + | {{#set: reaction not found=5}} |
− | {{#set: | + |
Revision as of 17:18, 10 January 2018
Pathway P23-PWY
- taxonomic range:
- common name:
- reductive TCA cycle I
- Synonym(s):
- reductive tricarboxylic acid cycle
- reductive tricarboxylic acid pathway
- reductive citric acid cycle
- reverse citric acid cycle
- carbon fixation
- CO2 fixation
- reductive carboxylic acid cycle
Reaction(s) found
- 7 reaction(s) found
Reaction(s) not found
- 5 reaction(s) not found