Difference between revisions of "HOMOCYSDEGR-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOCYSDEGR-PWY HOMOCYSDEGR-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33154 TAX-33154] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
− | ** | + | ** L-cysteine biosynthesis III (from L-homocysteine) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-homocysteine degradation |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''4''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[CYSTATHIONINE-BETA-SYNTHASE-RXN]] | |
− | * [[ | + | ** 2 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_7852]] |
+ | *** [[Tiso_gene_3732]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-14048]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_3732]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-15121]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[RXN-15123]] | ||
+ | ** 0 associated gene: | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-MAP: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00660 map00660] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-33154}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2157}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2}} |
− | {{#set: | + | {{#set: common name=L-cysteine biosynthesis III (from L-homocysteine)}} |
− | {{#set: | + | {{#set: common name=L-homocysteine degradation}} |
− | {{#set: common name= | + | {{#set: reaction found=4}} |
− | {{#set: | + | {{#set: total reaction=4}} |
− | {{#set: | + | {{#set: completion rate=100.0}} |
Latest revision as of 20:31, 21 March 2018
Pathway HOMOCYSDEGR-PWY
- taxonomic range:
- common name:
- L-cysteine biosynthesis III (from L-homocysteine)
- Synonym(s):
- L-homocysteine degradation
Reaction(s) found
4 reactions found over 4 reactions in the full pathway
- CYSTATHIONINE-BETA-SYNTHASE-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-14048
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-15121
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-15123
- 0 associated gene:
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP: