Difference between revisions of "HOMOSER-METSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6749 PWY-6749] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6749 PWY-6749] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** CMP-legionaminate biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** CMP-legionaminic acid biosynthesis I |
+ | ** 5,7-diacetamido-3,5,7,9-tetradeoxy-D-glycero-D-galacto-nonulosonic acid biosynthesis I | ||
+ | ** CMP-N, N-diacetyllegionaminate biosynthesis I | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''10''' reactions in the full pathway |
− | == Reaction(s) | + | * [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_9051]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=5.4.2.10-RXN 5.4.2.10-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12231 RXN-12231] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12232 RXN-12232] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12233 RXN-12233] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12234 RXN-12234] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12235 RXN-12235] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12236 RXN-12236] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12238 RXN-12238] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12239 RXN-12239] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=CMP-legionaminate biosynthesis I}} | |
− | + | {{#set: common name=CMP-legionaminic acid biosynthesis I|5,7-diacetamido-3,5,7,9-tetradeoxy-D-glycero-D-galacto-nonulosonic acid biosynthesis I|CMP-N, N-diacetyllegionaminate biosynthesis I}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=10.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:15, 18 March 2018
Pathway PWY-6749
- taxonomic range:
- common name:
- CMP-legionaminate biosynthesis I
- Synonym(s):
- CMP-legionaminic acid biosynthesis I
- 5,7-diacetamido-3,5,7,9-tetradeoxy-D-glycero-D-galacto-nonulosonic acid biosynthesis I
- CMP-N, N-diacetyllegionaminate biosynthesis I
Reaction(s) found
1 reactions found over 10 reactions in the full pathway
- L-GLN-FRUCT-6-P-AMINOTRANS-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated: