Difference between revisions of "HOMOSER-METSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11712 CPD-11712] == * smiles: ** CC(=CCCC(C)=CCCC(=CCCC(C)=CCC1(=C(O)C(C)=CC(O)=C1))C)C * i...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?ob...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-methionine biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-methionine biosynthesis from L-homoserine |
+ | ** L-methionine biosynthesis by transsulfuration | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[HOMOCYSMET-RXN]] | |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_1602]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[HOMOCYSMETB12-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_1602]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[O-SUCCHOMOSERLYASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_3732]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-15131]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_3732]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=HOMSUCTRAN-RXN HOMSUCTRAN-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=HOMOSER-METSYN-PWY HOMOSER-METSYN-PWY] |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=L-methionine biosynthesis I}} | |
− | + | {{#set: common name=L-methionine biosynthesis from L-homoserine|L-methionine biosynthesis by transsulfuration}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=80.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:31, 21 March 2018
Pathway HOMOSER-METSYN-PWY
- taxonomic range:
- common name:
- L-methionine biosynthesis I
- Synonym(s):
- L-methionine biosynthesis from L-homoserine
- L-methionine biosynthesis by transsulfuration
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- HOMOCYSMET-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- HOMOCYSMETB12-RXN
- 1 associated gene(s):
- 4 reconstruction source(s) associated:
- O-SUCCHOMOSERLYASE-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-15131
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: