Difference between revisions of "LYSINE-DEG1-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == * smiles: ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-DEG1-PWY LYSINE-DEG1-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=T...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=LYSINE-DEG1-PWY LYSINE-DEG1-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
−
** preQ0
+
** L-lysine degradation XI (mammalian)
−
* inchi key:
+
−
** InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 175.149   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 7-cyano-7-deazaguanine
 
−
** 7-cyano-7-carbaguanine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-12093]]
+
* [[1.2.1.31-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 5 associated gene(s):
 +
*** [[Tiso_gene_6563]]
 +
*** [[Tiso_gene_5424]]
 +
*** [[Tiso_gene_16719]]
 +
*** [[Tiso_gene_5425]]
 +
*** [[Tiso_gene_6562]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[1.5.1.8-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1156]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[1.5.1.9-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_7039]]
 +
*** [[Tiso_gene_1156]]
 +
*** [[Tiso_gene_10095]]
 +
*** [[Tiso_gene_7038]]
 +
*** [[Tiso_gene_9366]]
 +
*** [[Tiso_gene_4160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_9330]]
 +
*** [[Tiso_gene_10209]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03074
+
{{#set: taxonomic range=TAX-2759}}
−
* PUBCHEM:
+
{{#set: common name=L-lysine degradation XI (mammalian)}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=446357 446357]
+
{{#set: reaction found=5}}
−
* CHEMSPIDER:
+
{{#set: total reaction=5}}
−
** [http://www.chemspider.com/Chemical-Structure.393739.html 393739]
+
{{#set: completion rate=100.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45075 45075]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C15996 C15996]
+
−
{{#set: smiles=C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)}}
+
−
{{#set: common name=preQ0}}
+
−
{{#set: inchi key=InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=175.149    }}
+
−
{{#set: common name=7-cyano-7-deazaguanine|7-cyano-7-carbaguanine}}
+
−
{{#set: produced by=RXN-12093}}
+

Latest revision as of 20:07, 21 March 2018

Pathway LYSINE-DEG1-PWY

  • taxonomic range:
  • common name:
    • L-lysine degradation XI (mammalian)
  • Synonym(s):

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=LYSINE-DEG1-PWY&oldid=39655"