Difference between revisions of "MALONYL-COA-ACP-TRANSACYL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-FRUCTOSE BETA-D-FRUCTOSE] == * smiles: ** C(O)C1(OC(O)(CO)C(C1O)O) * inchi key: ** InChI...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA-ACP-TRANSACYL-RXN MALONYL-COA-ACP-TRANSACYL-RXN] == * direction: ** LEFT-TO-RIGHT * com...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-D-FRUCTOSE BETA-D-FRUCTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-COA-ACP-TRANSACYL-RXN MALONYL-COA-ACP-TRANSACYL-RXN] ==
* smiles:
+
* direction:
** C(O)C1(OC(O)(CO)C(C1O)O)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=RFSUNEUAIZKAJO-ARQDHWQXSA-N
+
 
* common name:
 
* common name:
** β-D-fructofuranose
+
** polyketide_synthase
* molecular weight:
+
** malonyl-_:acp_transacylase
** 180.157   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.39 EC-2.3.1.39]
 
* Synonym(s):
 
* Synonym(s):
** β-D-fructofuranose
 
** β-D-fructose
 
** β-fruit sugar
 
** β-Levulose
 
** β-D-arabino-Hexulose
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[FRUCTOKINASE-RXN]]
+
* With identifiers:
* [[KETOHEXOKINASE-RXN]]
+
** 1 [[ACP]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[MALONYL-ACP]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[3.2.1.48-RXN]]
+
** 1 a holo-[acyl-carrier protein][c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 a malonyl-[acp][c]
* [[RXN-9985]]
+
 
* [[RFH]]
+
== Genes associated with this reaction  ==
* [[RXN-14515]]
+
Genes have been associated with this reaction based on different elements listed below.
* [[BFFS]]
+
* Gene: [[Tiso_gene_10876]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_19309]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_18460]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6799]], fatty acid biosynthesis (plant mitochondria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6799 PWY-6799]
 +
** '''1''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-4381]], fatty acid biosynthesis initiation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439709 439709]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01626 R01626]
* HMDB : HMDB00660
+
* UNIPROT:
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P72391 P72391]
** [http://www.genome.jp/dbget-bin/www_bget?C02336 C02336]
+
** [http://www.uniprot.org/uniprot/P49327 P49327]
* CHEMSPIDER:
+
** [http://www.uniprot.org/uniprot/O34825 O34825]
** [http://www.chemspider.com/Chemical-Structure.388775.html 388775]
+
** [http://www.uniprot.org/uniprot/Q9RT24 Q9RT24]
* CHEBI:
+
** [http://www.uniprot.org/uniprot/Q9JW58 Q9JW58]
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28645 28645]
+
** [http://www.uniprot.org/uniprot/P0AAI9 P0AAI9]
* METABOLIGHTS : MTBLC28645
+
** [http://www.uniprot.org/uniprot/O24916 O24916]
{{#set: smiles=C(O)C1(OC(O)(CO)C(C1O)O)}}
+
** [http://www.uniprot.org/uniprot/Q9JXR4 Q9JXR4]
{{#set: inchi key=InChIKey=RFSUNEUAIZKAJO-ARQDHWQXSA-N}}
+
** [http://www.uniprot.org/uniprot/Q9ZCJ6 Q9ZCJ6]
{{#set: common name=β-D-fructofuranose}}
+
** [http://www.uniprot.org/uniprot/Q9YBK5 Q9YBK5]
{{#set: molecular weight=180.157    }}
+
** [http://www.uniprot.org/uniprot/Q9PJ11 Q9PJ11]
{{#set: common name=β-D-fructofuranose|β-D-fructose|β-fruit sugar|β-Levulose|β-D-arabino-Hexulose}}
+
** [http://www.uniprot.org/uniprot/P43712 P43712]
{{#set: consumed by=FRUCTOKINASE-RXN|KETOHEXOKINASE-RXN}}
+
** [http://www.uniprot.org/uniprot/Q9Z8P1 Q9Z8P1]
{{#set: produced by=3.2.1.48-RXN|RXN-9985|RFH|RXN-14515|BFFS}}
+
** [http://www.uniprot.org/uniprot/O67041 O67041]
 +
** [http://www.uniprot.org/uniprot/Q9ZMY1 Q9ZMY1]
 +
** [http://www.uniprot.org/uniprot/Q9PKF6 Q9PKF6]
 +
** [http://www.uniprot.org/uniprot/P63458 P63458]
 +
** [http://www.uniprot.org/uniprot/O84241 O84241]
 +
** [http://www.uniprot.org/uniprot/Q9WZQ5 Q9WZQ5]
 +
** [http://www.uniprot.org/uniprot/P71019 P71019]
 +
** [http://www.uniprot.org/uniprot/P07149 P07149]
 +
** [http://www.uniprot.org/uniprot/P73242 P73242]
 +
** [http://www.uniprot.org/uniprot/Q8RU07 Q8RU07]
 +
** [http://www.uniprot.org/uniprot/Q54205 Q54205]
 +
** [http://www.uniprot.org/uniprot/O54437 O54437]
 +
** [http://www.uniprot.org/uniprot/Q56692 Q56692]
 +
** [http://www.uniprot.org/uniprot/O13698 O13698]
 +
** [http://www.uniprot.org/uniprot/Q9RA34 Q9RA34]
 +
** [http://www.uniprot.org/uniprot/O69476 O69476]
 +
** [http://www.uniprot.org/uniprot/P12276 P12276]
 +
** [http://www.uniprot.org/uniprot/P12785 P12785]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=polyketide_synthase}}
 +
{{#set: common name=malonyl-_:acp_transacylase}}
 +
{{#set: ec number=EC-2.3.1.86}}
 +
{{#set: ec number=EC-2.3.1.85}}
 +
{{#set: ec number=EC-2.3.1.39}}
 +
{{#set: gene associated=Tiso_gene_10876|Tiso_gene_136|Tiso_gene_19309|Tiso_gene_135|Tiso_gene_18460|Tiso_gene_500|Tiso_gene_13394}}
 +
{{#set: in pathway=PWY-6799|PWY-7388|PWY-4381}}
 +
{{#set: reconstruction category=orthology|manual|annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation|manual-primary_network|annotation-experimental_annotation|orthology-synechocystis|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 21:18, 21 March 2018

Reaction MALONYL-COA-ACP-TRANSACYL-RXN

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a holo-[acyl-carrier protein][c] + 1 malonyl-CoA[c] => 1 coenzyme A[c] + 1 a malonyl-[acp][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6799, fatty acid biosynthesis (plant mitochondria): PWY-6799
    • 1 reactions found over 4 reactions in the full pathway
  • PWY-7388, octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): PWY-7388
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-4381, fatty acid biosynthesis initiation I: PWY-4381
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links