Difference between revisions of "MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] == * smiles: ** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1) * inchi key: **...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] == * taxonomic range: ** [...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11552 CPD-11552] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
+
** protein N-glycosylation (eukaryotic, high mannose)
−
* molecular weight:
+
−
** 222.177   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** mannosyl-chito-dolichol biosynthesis
 +
** eukaryotic N-linked glycosylation
 +
** dolichyl-diphosphooligosaccharide biosynthesis and attachment
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''19''' reactions found over '''19''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[2.4.1.117-RXN]]
−
* [[RXN-10721]]
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_8160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[2.4.1.119-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_26]]
 +
*** [[Tiso_gene_10448]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[2.4.1.141-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[2.4.1.142-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8387]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[2.4.1.83-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_16772]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[2.7.8.15-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1604]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-16592]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16593]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16594]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-5462]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_16872]]
 +
*** [[Tiso_gene_10734]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5463]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-5464]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15849]]
 +
*** [[Tiso_gene_15372]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5466]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8232]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5467]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8232]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5468]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8232]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5469]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8232]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-5470]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-5471]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-5472]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_15050]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21145116 21145116]
+
{{#set: common name=protein N-glycosylation (eukaryotic, high mannose)}}
−
* CHEMSPIDER:
+
{{#set: common name=mannosyl-chito-dolichol biosynthesis|eukaryotic N-linked glycosylation|dolichyl-diphosphooligosaccharide biosynthesis and attachment}}
−
** [http://www.chemspider.com/Chemical-Structure.20016009.html 20016009]
+
{{#set: reaction found=19}}
−
* LIGAND-CPD:
+
{{#set: total reaction=19}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05645 C05645]
+
{{#set: completion rate=100.0}}
−
* HMDB : HMDB04083
+
−
{{#set: smiles=C(=O)([O-])C(=O)CC(=O)C1(C=CC=C(O)C(N)=1)}}
+
−
{{#set: inchi key=InChIKey=YCJNYHCCOXVYAF-UHFFFAOYSA-M}}
+
−
{{#set: common name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}}
+
−
{{#set: molecular weight=222.177    }}
+
−
{{#set: consumed or produced by=RXN-10721}}
+

Latest revision as of 20:18, 21 March 2018

Pathway MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS

  • taxonomic range:
  • common name:
    • protein N-glycosylation (eukaryotic, high mannose)
  • Synonym(s):
    • mannosyl-chito-dolichol biosynthesis
    • eukaryotic N-linked glycosylation
    • dolichyl-diphosphooligosaccharide biosynthesis and attachment

Reaction(s) found

19 reactions found over 19 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS&oldid=40757"