Difference between revisions of "NADPHOS-DEPHOS-PWY-1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY-1 NADPHOS-DEPHOS-PWY-1] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAG...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=NADPHOS-DEPHOS-PWY-1 NADPHOS-DEPHOS-PWY-1] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
− | ** | + | ** NAD phosphorylation and transhydrogenation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''2''' reactions in the full pathway |
− | * [[ | + | * [[NAD-KIN-RXN]] |
− | + | ** 3 associated gene(s): | |
− | * [[ | + | *** [[Tiso_gene_1163]] |
− | == Reaction(s) | + | *** [[Tiso_gene_14560]] |
+ | *** [[Tiso_gene_1420]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=TRANS-RXN0-277 TRANS-RXN0-277] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=NAD phosphorylation and transhydrogenation}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=2}} | |
− | + | {{#set: completion rate=50.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:14, 21 March 2018
Contents
Pathway NADPHOS-DEPHOS-PWY-1
- taxonomic range:
- common name:
- NAD phosphorylation and transhydrogenation
- Synonym(s):
Reaction(s) found
1 reactions found over 2 reactions in the full pathway
- NAD-KIN-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated: