Difference between revisions of "NTPD"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] == * smiles: ** C(COP([O-])(=O)[O-])C([N+])C([O-...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=NTPD NTPD] == * direction: ** LEFT-TO-RIGHT * common name: ** nucleoside-triphosphate diphosphatase...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=NTPD NTPD] ==
* smiles:
+
* direction:
** C(COP([O-])(=O)[O-])C([N+])C([O-])=O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=FXDNYOANAXWZHG-VKHMYHEASA-L
+
 
* common name:
 
* common name:
** O-phospho-L-homoserine
+
** nucleoside-triphosphate diphosphatase (XTP)
* molecular weight:
+
** 197.084   
+
 
* Synonym(s):
 
* Synonym(s):
** o-phosphohomoserine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-12728]]
+
* With identifiers:
* [[THRESYN-RXN]]
+
** 1.0 [[XTP]][c] '''+''' 1.0 [[WATER]][c] '''=>''' 1.0 [[XANTHOSINE-5-PHOSPHATE]][c] '''+''' 1.0 [[PPI]][c] '''+''' 1.0 [[PROTON]][c]
== Reaction(s) known to produce the compound ==
+
* With common name(s):
* [[HOMOSERKIN-RXN]]
+
** 1.0 XTP[c] '''+''' 1.0 H2O[c] '''=>''' 1.0 XMP[c] '''+''' 1.0 diphosphate[c] '''+''' 1.0 H+[c]
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18793]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* BIGG : phom
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=nucleoside-triphosphate diphosphatase (XTP)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878406 46878406]
+
{{#set: gene associated=Tiso_gene_18793}}
* HMDB : HMDB03484
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C01102 C01102]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57590 57590]
+
* METABOLIGHTS : MTBLC57590
+
{{#set: smiles=C(COP([O-])(=O)[O-])C([N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=FXDNYOANAXWZHG-VKHMYHEASA-L}}
+
{{#set: common name=O-phospho-L-homoserine}}
+
{{#set: molecular weight=197.084    }}
+
{{#set: common name=o-phosphohomoserine}}
+
{{#set: consumed by=RXN-12728|THRESYN-RXN}}
+
{{#set: produced by=HOMOSERKIN-RXN}}
+

Latest revision as of 21:26, 21 March 2018

Reaction NTPD

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • nucleoside-triphosphate diphosphatase (XTP)
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 XTP[c] + 1.0 H2O[c] => 1.0 XMP[c] + 1.0 diphosphate[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links