Difference between revisions of "ORNDEG-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * common name:...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ORNDEG-PWY ORNDEG-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=ORNDEG-PWY ORNDEG-PWY] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
| − | ** | + | ** superpathway of ornithine degradation |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''2''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[ORNDECARBOX-RXN]] | |
| − | * [[ | + | ** 1 associated gene(s): |
| − | * [[ | + | *** [[Tiso_gene_10737]] |
| − | == Reaction(s) | + | ** 1 reconstruction source(s) associated: |
| − | * [ | + | *** [[orthology-esiliculosus]] |
| + | * [[PUTDEG-PWY]] | ||
| + | ** 0 associated gene: | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1221 PWY0-1221] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1221 PWY0-1221] | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=ORNDEG-PWY ORNDEG-PWY] |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=superpathway of ornithine degradation}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:27, 21 March 2018
Pathway ORNDEG-PWY
- taxonomic range:
- common name:
- superpathway of ornithine degradation
- Synonym(s):
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- ORNDECARBOX-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PUTDEG-PWY
- 0 associated gene:
Reaction(s) not found
External links
- ECOCYC:
