Difference between revisions of "P162-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-32066 TAX-32066]
−
** InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N
+
 
* common name:
 
* common name:
−
** lotaustralin
+
** L-glutamate degradation V (via hydroxyglutarate)
−
* molecular weight:
+
−
** 261.274   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside
+
** L-glutamate fermentation
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-9674]]
+
'''4''' reactions found over '''11''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
−
* [[RXN-13603]]
+
** 3 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_16181]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_17451]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLUTAMATE-DEHYDROGENASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2337]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11662]]
 +
** 7 associated gene(s):
 +
*** [[Tiso_gene_16703]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_5857]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11667]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_5857]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-ADP-FORMING-RXN ACETATE--COA-LIGASE-ADP-FORMING-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUTACONYL-COA-DECARBOXYLASE-RXN GLUTACONYL-COA-DECARBOXYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=KETOGLUTREDUCT-RXN KETOGLUTREDUCT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1082 RXN-1082]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1083 RXN-1083]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=441467 441467]
+
{{#set: taxonomic range=TAX-32066}}
−
* CHEBI:
+
{{#set: common name=L-glutamate degradation V (via hydroxyglutarate)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6542 6542]
+
{{#set: common name=L-glutamate fermentation}}
−
* LIGAND-CPD:
+
{{#set: reaction found=4}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08334 C08334]
+
{{#set: total reaction=11}}
−
* HMDB : HMDB33865
+
{{#set: completion rate=36.0}}
−
{{#set: smiles=CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=WEWBWVMTOYUPHH-QHAQEBJBSA-N}}
+
−
{{#set: common name=lotaustralin}}
+
−
{{#set: molecular weight=261.274    }}
+
−
{{#set: common name=2-hydroxy-2-methylbutyronitrile-beta-D-glucopyranoside}}
+
−
{{#set: consumed by=RXN-9674}}
+
−
{{#set: produced by=RXN-13603}}
+

Latest revision as of 20:49, 21 March 2018

Pathway P162-PWY

  • taxonomic range:
  • common name:
    • L-glutamate degradation V (via hydroxyglutarate)
  • Synonym(s):
    • L-glutamate fermentation

Reaction(s) found

4 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=P162-PWY&oldid=44029"