Difference between revisions of "P162-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * inchi key: ** InChIK...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P162-PWY P162-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-32066 TAX-32066] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** L-glutamate degradation V (via hydroxyglutarate) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-glutamate fermentation |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''11''' reactions in the full pathway |
− | == Reaction(s) | + | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] |
− | * [[RXN- | + | ** 3 associated gene(s): |
− | == | + | *** [[Tiso_gene_16181]] |
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[GLUTAMATE-DEHYDROGENASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_2337]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-11662]] | ||
+ | ** 7 associated gene(s): | ||
+ | *** [[Tiso_gene_16703]] | ||
+ | *** [[Tiso_gene_14027]] | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_14026]] | ||
+ | *** [[Tiso_gene_18838]] | ||
+ | *** [[Tiso_gene_18839]] | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-11667]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ACETATE--COA-LIGASE-ADP-FORMING-RXN ACETATE--COA-LIGASE-ADP-FORMING-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRYL-COA-DEHYDROGENASE-RXN BUTYRYL-COA-DEHYDROGENASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLUTACONYL-COA-DECARBOXYLASE-RXN GLUTACONYL-COA-DECARBOXYLASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=KETOGLUTREDUCT-RXN KETOGLUTREDUCT-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=R11-RXN R11-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1082 RXN-1082] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1083 RXN-1083] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-1239}} | |
− | + | {{#set: taxonomic range=TAX-32066}} | |
− | + | {{#set: common name=L-glutamate degradation V (via hydroxyglutarate)}} | |
− | + | {{#set: common name=L-glutamate fermentation}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=11}} | |
− | + | {{#set: completion rate=36.0}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:49, 21 March 2018
Pathway P162-PWY
- taxonomic range:
- common name:
- L-glutamate degradation V (via hydroxyglutarate)
- Synonym(s):
- L-glutamate fermentation
Reaction(s) found
4 reactions found over 11 reactions in the full pathway
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- GLUTAMATE-DEHYDROGENASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- RXN-11662
- 7 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN-11667
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
- ACETATE--COA-LIGASE-ADP-FORMING-RXN
- BUTYRYL-COA-DEHYDROGENASE-RXN
- GLUTACONYL-COA-DECARBOXYLASE-RXN
- KETOGLUTREDUCT-RXN
- R11-RXN
- RXN-1082
- RXN-1083