Difference between revisions of "P42-PWY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-22...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14420 CPD-14420] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P42-PWY P42-PWY] ==
* smiles:
+
* taxonomic range:
** CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-224756 TAX-224756]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183939 TAX-183939]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183925 TAX-183925]
 
* common name:
 
* common name:
** icosatrienoyl-2-enoyl CoA
+
** incomplete reductive TCA cycle
* inchi key:
+
** InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J
+
* molecular weight:
+
** 1049.959   
+
 
* Synonym(s):
 
* Synonym(s):
** 18:3Δ9,12,15
+
** citric acid cycle variant
** (9Z,12Z,15Z)-octadecatrienoyl-CoA
+
** tricarboxylic acid cycle variant
** eicosatrienoyl-2-enoyl CoA
+
** TCA cycle variation I
 +
** incomplete reductive tricarboxylic acid cycle
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12997]]
+
'''4''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FUMHYDR-RXN]]
* [[RXN-13001]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_3691]]
 +
*** [[Tiso_gene_6720]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_2323]]
 +
*** [[Tiso_gene_1990]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_15144]]
 +
*** [[Tiso_gene_15145]]
 +
*** [[Tiso_gene_2812]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15846]]
 +
*** [[Tiso_gene_11866]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2-OXOGLUTARATE-SYNTHASE-RXN 2-OXOGLUTARATE-SYNTHASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PYRUFLAVREDUCT-RXN PYRUFLAVREDUCT-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=R601-RXN R601-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-224756}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72551551 72551551]
+
{{#set: taxonomic range=TAX-183939}}
* CHEBI:
+
{{#set: taxonomic range=TAX-183925}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76456 76456]
+
{{#set: common name=incomplete reductive TCA cycle}}
{{#set: smiles=CCC=CCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=citric acid cycle variant|tricarboxylic acid cycle variant|TCA cycle variation I|incomplete reductive tricarboxylic acid cycle}}
{{#set: common name=icosatrienoyl-2-enoyl CoA}}
+
{{#set: reaction found=4}}
{{#set: inchi key=InChIKey=YJKOIKYLHSMLHC-ATRRWJJYSA-J}}
+
{{#set: total reaction=7}}
{{#set: molecular weight=1049.959    }}
+
{{#set: completion rate=57.0}}
{{#set: common name=18:3Δ9,12,15|(9Z,12Z,15Z)-octadecatrienoyl-CoA|eicosatrienoyl-2-enoyl CoA}}
+
{{#set: consumed by=RXN-12997}}
+
{{#set: produced by=RXN-13001}}
+

Latest revision as of 20:47, 21 March 2018

Pathway P42-PWY

  • taxonomic range:
  • common name:
    • incomplete reductive TCA cycle
  • Synonym(s):
    • citric acid cycle variant
    • tricarboxylic acid cycle variant
    • TCA cycle variation I
    • incomplete reductive tricarboxylic acid cycle

Reaction(s) found

4 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links