Difference between revisions of "PEPDEPHOS-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == * smiles: ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5283 RXN-5283] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5283 RXN-5283] ==
−
* smiles:
+
* direction:
−
** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N
+
−
* common name:
+
−
** pregn-5-ene-3,20-dione
+
−
* molecular weight:
+
−
** 314.467   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-353]]
+
** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[13-HYDROXY-MAGNESIUM-PROTOPORP]][c] '''=>''' 1 [[131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M]][c] '''+''' 1 [[NADP]][c] '''+''' 2 [[WATER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 H+[c] '''+''' 1 131-hydroxy-magnesium-protoporphyrin IX 13-monomethyl ester[c] '''=>''' 1 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester[c] '''+''' 1 NADP+[c] '''+''' 2 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[CHLOROPHYLL-SYN]], 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-SYN CHLOROPHYLL-SYN]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7159]], 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159]
 +
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=150901 150901]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20542 20542]
−
* CHEMSPIDER:
+
* LIGAND-RXN:
−
** [http://www.chemspider.com/Chemical-Structure.546029.html 546029]
+
** [http://www.genome.jp/dbget-bin/www_bget?R06266 R06266]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63837 63837]
+
{{#set: in pathway=CHLOROPHYLL-SYN|PWY-7159}}
−
{{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: reconstruction category=manual}}
−
{{#set: inchi key=InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N}}
+
{{#set: reconstruction source=manual-primary_network}}
−
{{#set: common name=pregn-5-ene-3,20-dione}}
+
−
{{#set: molecular weight=314.467    }}
+
−
{{#set: produced by=RXN66-353}}
+

Revision as of 19:34, 18 March 2018

Reaction RXN-5283

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • CHLOROPHYLL-SYN, 3,8-divinyl-chlorophyllide a biosynthesis I (aerobic, light-dependent): CHLOROPHYLL-SYN
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-7159, 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent): PWY-7159
    • 8 reactions found over 9 reactions in the full pathway

Reconstruction information

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PEPDEPHOS-RXN&oldid=25415"