Difference between revisions of "PROLINE-RACEMASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN] == * direction: ** REVERSIBLE * common name: ** proline_...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** proline_racemase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.1.1.4 EC-5.1.1.4] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[PRO]][c] '''<=>''' 1 [[D-PROLINE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 L-proline[c] '''<=>''' 1 D-proline[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13061]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-6344]], L-ornithine degradation II (Stickland reaction): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344] | ||
+ | ** '''4''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10680 10680] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01255 R01255] |
− | + | {{#set: direction=REVERSIBLE}} | |
− | {{#set: | + | {{#set: common name=proline_racemase}} |
− | {{#set: | + | {{#set: ec number=EC-5.1.1.4}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_13061}} |
− | {{#set: | + | {{#set: in pathway=PWY-6344}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 21:00, 21 March 2018
Contents
Reaction PROLINE-RACEMASE-RXN
- direction:
- REVERSIBLE
- common name:
- proline_racemase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 L-proline[c] <=> 1 D-proline[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13061
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-6344, L-ornithine degradation II (Stickland reaction): PWY-6344
- 4 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links