Difference between revisions of "PROT-CYS"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenzy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROT-CYS PROT-CYS] == * common name: ** a [protein]-L-cysteine * Synonym(s): ** peptide cystein...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROT-CYS PROT-CYS] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [protein]-L-cysteine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** peptide cysteine |
+ | ** peptidyl cysteine | ||
+ | ** [enzyme]-cysteine | ||
+ | ** protein-cysteine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.1.1.63-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.5.1.58-RXN]] | ||
+ | * [[RXN-3701]] | ||
+ | * [[1.11.1.15-RXN]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [protein]-L-cysteine}} | |
− | + | {{#set: common name=peptide cysteine|peptidyl cysteine|[enzyme]-cysteine|protein-cysteine}} | |
− | + | {{#set: consumed by=2.1.1.63-RXN}} | |
− | + | {{#set: reversible reaction associated=2.5.1.58-RXN|RXN-3701|1.11.1.15-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 21:25, 21 March 2018
Contents
Metabolite PROT-CYS
- common name:
- a [protein]-L-cysteine
- Synonym(s):
- peptide cysteine
- peptidyl cysteine
- [enzyme]-cysteine
- protein-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [protein]-L-cysteine" cannot be used as a page name in this wiki.
"enzyme]-cysteine" cannot be used as a page name in this wiki.