Difference between revisions of "PWY-1042"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * common name: ** L-cys...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* common name: | * common name: | ||
− | ** | + | ** glycolysis IV (plant cytosol) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** glycolysis 4 | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''9''' reactions found over '''10''' reactions in the full pathway |
− | * [[ | + | * [[2.7.1.90-RXN]] |
− | + | ** 1 associated gene(s): | |
− | == Reaction(s) | + | *** [[Tiso_gene_596]] |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[2PGADEHYDRAT-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_8720]] | ||
+ | *** [[Tiso_gene_14718]] | ||
+ | *** [[Tiso_gene_5619]] | ||
+ | *** [[Tiso_gene_13317]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[3PGAREARR-RXN]] | ||
+ | ** 16 associated gene(s): | ||
+ | *** [[Tiso_gene_15048]] | ||
+ | *** [[Tiso_gene_7201]] | ||
+ | *** [[Tiso_gene_9922]] | ||
+ | *** [[Tiso_gene_2841]] | ||
+ | *** [[Tiso_gene_14530]] | ||
+ | *** [[Tiso_gene_16754]] | ||
+ | *** [[Tiso_gene_2365]] | ||
+ | *** [[Tiso_gene_16271]] | ||
+ | *** [[Tiso_gene_5468]] | ||
+ | *** [[Tiso_gene_20311]] | ||
+ | *** [[Tiso_gene_14664]] | ||
+ | *** [[Tiso_gene_15391]] | ||
+ | *** [[Tiso_gene_14212]] | ||
+ | *** [[Tiso_gene_10516]] | ||
+ | *** [[Tiso_gene_9923]] | ||
+ | *** [[Tiso_gene_2667]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[6PFRUCTPHOS-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_5733]] | ||
+ | *** [[Tiso_gene_596]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[F16ALDOLASE-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_12272]] | ||
+ | *** [[Tiso_gene_65]] | ||
+ | *** [[Tiso_gene_9119]] | ||
+ | *** [[Tiso_gene_14568]] | ||
+ | *** [[Tiso_gene_9179]] | ||
+ | *** [[Tiso_gene_9118]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[GAPOXNPHOSPHN-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_20000]] | ||
+ | *** [[Tiso_gene_235]] | ||
+ | *** [[Tiso_gene_10646]] | ||
+ | *** [[Tiso_gene_3344]] | ||
+ | *** [[Tiso_gene_6766]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[PEPDEPHOS-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_18206]] | ||
+ | *** [[Tiso_gene_14504]] | ||
+ | *** [[Tiso_gene_974]] | ||
+ | *** [[Tiso_gene_14505]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_3526]] | ||
+ | *** [[Tiso_gene_18264]] | ||
+ | *** [[Tiso_gene_3527]] | ||
+ | *** [[Tiso_gene_18263]] | ||
+ | *** [[Tiso_gene_12104]] | ||
+ | *** [[Tiso_gene_14642]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[TRIOSEPISOMERIZATION-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_19961]] | ||
+ | *** [[Tiso_gene_20000]] | ||
+ | *** [[Tiso_gene_19962]] | ||
+ | *** [[Tiso_gene_10646]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=1.2.1.9-RXN 1.2.1.9-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-1042 PWY-1042] | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-33090}} |
− | + | {{#set: common name=glycolysis IV (plant cytosol)}} | |
− | + | {{#set: common name=glycolysis 4}} | |
− | + | {{#set: reaction found=9}} | |
− | + | {{#set: total reaction=10}} | |
− | + | {{#set: completion rate=90.0}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:24, 21 March 2018
Pathway PWY-1042
- taxonomic range:
- common name:
- glycolysis IV (plant cytosol)
- Synonym(s):
- glycolysis 4
Reaction(s) found
9 reactions found over 10 reactions in the full pathway
- 2.7.1.90-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- 2PGADEHYDRAT-RXN
- 4 associated gene(s):
- 7 reconstruction source(s) associated:
- 3PGAREARR-RXN
- 16 associated gene(s):
- 7 reconstruction source(s) associated:
- 6PFRUCTPHOS-RXN
- 2 associated gene(s):
- 6 reconstruction source(s) associated:
- F16ALDOLASE-RXN
- 6 associated gene(s):
- 5 reconstruction source(s) associated:
- GAPOXNPHOSPHN-RXN
- 5 associated gene(s):
- 7 reconstruction source(s) associated:
- PEPDEPHOS-RXN
- 4 associated gene(s):
- 7 reconstruction source(s) associated:
- PHOSGLYPHOS-RXN
- 6 associated gene(s):
- 7 reconstruction source(s) associated:
- TRIOSEPISOMERIZATION-RXN
- 4 associated gene(s):
- 7 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: