Difference between revisions of "PWY-1422"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * smiles: ** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1) * inchi key: ** InC...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-241806]
+
** C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
+
** InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3312 TAX-3312]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208]
+
 
* common name:
 
* common name:
** 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
+
** dopamine 3-O-sulfate
 +
* molecular weight:
 +
** 233.239   
 
* Synonym(s):
 
* Synonym(s):
** light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis
+
** 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
 +
** 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''8''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[RXN1F-20]]
+
* [[RXN6666-9]]
** [[RXN0-1461]]
+
== Reaction(s) of unknown directionality ==
** [[RXN-5282]]
+
** [[RXN-5283]]
+
** [[RXN-5284]]
+
** [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
+
** [[UROGENDECARBOX-RXN]]
+
** [[PROTOPORGENOXI-RXN]]
+
== Reaction(s) not found ==
+
* '''1''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=RXN-17485 RXN-17485]
+
 
== External links  ==
 
== External links  ==
* PLANTCYC : PWY-7159
+
* LIGAND-CPD:
{{#set: taxonomic range=TAX-241806}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C13690 C13690]
{{#set: taxonomic range=TAX-2}}
+
* CHEBI:
{{#set: taxonomic range=TAX-1117}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133524 133524]
{{#set: taxonomic range=TAX-3041}}
+
* METABOLIGHTS : MTBLC37946
{{#set: taxonomic range=TAX-3312}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-3208}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201578 25201578]
{{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)}}
+
* HMDB : HMDB06275
{{#set: common name=light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis}}
+
{{#set: smiles=C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)}}
{{#set: reaction found=8}}
+
{{#set: inchi key=InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N}}
{{#set: reaction not found=1}}
+
{{#set: common name=dopamine 3-O-sulfate}}
 +
{{#set: molecular weight=233.239    }}
 +
{{#set: common name=5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate|4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)}}
 +
{{#set: produced by=RXN6666-9}}

Revision as of 16:59, 10 January 2018

Metabolite CPD-7649

  • smiles:
    • C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)
  • inchi key:
    • InChIKey=NZKRYJGNYPYXJZ-UHFFFAOYSA-N
  • common name:
    • dopamine 3-O-sulfate
  • molecular weight:
    • 233.239
  • Synonym(s):
    • 5-(2-aminoethyl)-2-hydroxyphenyl hydrogen sulfate
    • 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(=C(CC[N+])C=C(OS(=O)(=O)[O-])C(O)=C1)" cannot be used as a page name in this wiki.