Difference between revisions of "PWY-2002"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE L-ASPARTATE] == * smiles: ** C(C(=O)[O-])C([N+])C(=O)[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-38...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2002 PWY-2002] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** isoflavonoid biosynthesis I |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | * | + | * [[RXN-3221]] |
− | * | + | ** 2 associated gene(s): |
− | * | + | *** [[Tiso_gene_13414]] |
− | * | + | *** [[Tiso_gene_9838]] |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
− | * | + | *** [[annotation-in-silico_annotation]] |
− | * | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | == Reaction(s) not found == |
− | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3283 RXN-3283] |
− | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3284 RXN-3284] |
− | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3481 RXN-3481] | |
− | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3501 RXN-3501] |
− | * [[ | + | |
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
− | * [ | + | |
− | + | ||
− | * [ | + | |
− | * [ | + | |
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3803}} | |
− | + | {{#set: common name=isoflavonoid biosynthesis I}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 20:44, 21 March 2018
Pathway PWY-2002
- taxonomic range:
- common name:
- isoflavonoid biosynthesis I
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- RXN-3221
- 2 associated gene(s):
- 2 reconstruction source(s) associated: