Difference between revisions of "PWY-2221"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAP GAP] == * smiles: ** [CH](=O)C(O)COP(=O)([O-])[O-] * inchi key: ** InChIKey=LXJXRIRHZLFYRP-...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183963 TAX-...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-2221 PWY-2221] == |
− | * | + | * taxonomic range: |
− | ** [ | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183963 TAX-183963] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-183924 TAX-183924] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** Entner-Doudoroff pathway III (semi-phosphorylative) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''5''' reactions found over '''9''' reactions in the full pathway |
− | + | * [[2PGADEHYDRAT-RXN]] | |
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_8720]] | ||
+ | *** [[Tiso_gene_14718]] | ||
+ | *** [[Tiso_gene_5619]] | ||
+ | *** [[Tiso_gene_13317]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[3PGAREARR-RXN]] | ||
+ | ** 16 associated gene(s): | ||
+ | *** [[Tiso_gene_15048]] | ||
+ | *** [[Tiso_gene_7201]] | ||
+ | *** [[Tiso_gene_9922]] | ||
+ | *** [[Tiso_gene_2841]] | ||
+ | *** [[Tiso_gene_14530]] | ||
+ | *** [[Tiso_gene_16754]] | ||
+ | *** [[Tiso_gene_2365]] | ||
+ | *** [[Tiso_gene_16271]] | ||
+ | *** [[Tiso_gene_5468]] | ||
+ | *** [[Tiso_gene_20311]] | ||
+ | *** [[Tiso_gene_14664]] | ||
+ | *** [[Tiso_gene_15391]] | ||
+ | *** [[Tiso_gene_14212]] | ||
+ | *** [[Tiso_gene_10516]] | ||
+ | *** [[Tiso_gene_9923]] | ||
+ | *** [[Tiso_gene_2667]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[GLUCONOLACT-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_1947]] | ||
+ | *** [[Tiso_gene_15098]] | ||
+ | *** [[Tiso_gene_1948]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
* [[KDPGALDOL-RXN]] | * [[KDPGALDOL-RXN]] | ||
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_12620]] |
− | + | ** 1 reconstruction source(s) associated: | |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | * [[PEPDEPHOS-RXN]] |
− | * [[ | + | ** 4 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_18206]] |
− | * [[ | + | *** [[Tiso_gene_14504]] |
− | * [[ | + | *** [[Tiso_gene_974]] |
− | * [[ | + | *** [[Tiso_gene_14505]] |
− | * [[ | + | ** 7 reconstruction source(s) associated: |
− | * [[ | + | *** [[annotation-experimental_annotation]] |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=DEOXYGLUCONOKIN-RXN DEOXYGLUCONOKIN-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE-DEHYDRATASE-RXN GLUCONATE-DEHYDRATASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSE-1-DEHYDROGENASE-NADP+-RXN GLUCOSE-1-DEHYDROGENASE-NADP+-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-3443 RXN-3443] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-183963}} | |
− | + | {{#set: taxonomic range=TAX-183924}} | |
− | + | {{#set: common name=Entner-Doudoroff pathway III (semi-phosphorylative)}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=56.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:40, 21 March 2018
Pathway PWY-2221
- taxonomic range:
- common name:
- Entner-Doudoroff pathway III (semi-phosphorylative)
- Synonym(s):
Reaction(s) found
5 reactions found over 9 reactions in the full pathway
- 2PGADEHYDRAT-RXN
- 4 associated gene(s):
- 7 reconstruction source(s) associated:
- 3PGAREARR-RXN
- 16 associated gene(s):
- 7 reconstruction source(s) associated:
- GLUCONOLACT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- KDPGALDOL-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- PEPDEPHOS-RXN
- 4 associated gene(s):
- 7 reconstruction source(s) associated: