Difference between revisions of "PWY-2941"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp GDR_nadp] == * direction: ** LEFT-TO-RIGHT * common name: ** glutathione-disulfide reducta...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] == * smiles: ** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GDR_nadp GDR_nadp] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6947 CPD-6947] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C
 
* common name:
 
* common name:
−
** glutathione-disulfide reductase (NADP)
+
** demethylphylloquinone
 +
* inchi key:
 +
** InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N
 +
* molecular weight:
 +
** 436.676   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-phytyl-1,4-naphtoquinone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[R06859]]
−
** 1.0 [[PROTON]][c] '''+''' 1.0 [[OXIDIZED-GLUTATHIONE]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 2.0 [[GLUTATHIONE]][c] '''+''' 1.0 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[R06858]]
−
** 1.0 H+[c] '''+''' 1.0 glutathione disulfide[c] '''+''' 1.0 NADPH[c] '''=>''' 2.0 glutathione[c] '''+''' 1.0 NADP+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2804]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_12533]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=glutathione-disulfide reductase (NADP)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927684 56927684]
−
{{#set: gene associated=Tiso_gene_2804|Tiso_gene_12533}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.10128305.html 10128305]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB04649
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31087 31087]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C13309 C13309]
 +
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C}}
 +
{{#set: common name=demethylphylloquinone}}
 +
{{#set: inchi key=InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N}}
 +
{{#set: molecular weight=436.676    }}
 +
{{#set: common name=2-phytyl-1,4-naphtoquinone}}
 +
{{#set: consumed by=R06859}}
 +
{{#set: produced by=R06858}}

Revision as of 15:46, 21 March 2018

Metabolite CPD-6947

  • smiles:
    • CC(CCCC(CCCC(C)CCCC(=CCC2(=CC(=O)C1(C(=CC=CC=1)C(=O)2)))C)C)C
  • common name:
    • demethylphylloquinone
  • inchi key:
    • InChIKey=UDYIPZFWVJJQJF-KQPZCCJBSA-N
  • molecular weight:
    • 436.676
  • Synonym(s):
    • 2-phytyl-1,4-naphtoquinone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-2941&oldid=30121"