Difference between revisions of "PWY-3301"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3301 PWY-3301] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-37...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3301 PWY-3301] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3700 TAX-3700] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sinapate ester biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[2.3.1.91-RXN]] | |
− | * [[ | + | ** 3 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_14881]] |
− | == Reaction(s) | + | *** [[Tiso_gene_11785]] |
− | * [[2. | + | *** [[Tiso_gene_514]] |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.103-RXN 2.3.1.103-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.92-RXN 2.3.1.92-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SINAPATE-1-GLUCOSYLTRANSFERASE-RXN SINAPATE-1-GLUCOSYLTRANSFERASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SINAPINE-ESTERASE-RXN SINAPINE-ESTERASE-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3301 PWY-3301] |
− | + | {{#set: taxonomic range=TAX-3700}} | |
− | + | {{#set: common name=sinapate ester biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=5}} | |
− | + | {{#set: completion rate=20.0}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:27, 21 March 2018
Pathway PWY-3301
- taxonomic range:
- common name:
- sinapate ester biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- 2.3.1.91-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: