Difference between revisions of "PWY-3861"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * smiles: ** CC(C(SC(CCCCC(N)=O)CCS)=O)C * inchi key: ** InChIKey=XZUKURPVW...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-5...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3861 PWY-3861] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58023 TAX-58023] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** mannitol degradation II |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''4''' reactions in the full pathway |
− | + | * [[1.1.1.255-RXN]] | |
− | == Reaction(s) | + | ** 0 associated gene: |
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[MANNKIN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_3107]] | ||
+ | *** [[Tiso_gene_1303]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[RXN-14500]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=MANNPISOM-RXN MANNPISOM-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-58023}} | |
− | + | {{#set: common name=mannitol degradation II}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=4}} | |
− | {{#set: | + | {{#set: completion rate=75.0}} |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:48, 21 March 2018
Pathway PWY-3861
- taxonomic range:
- common name:
- mannitol degradation II
- Synonym(s):
Reaction(s) found
3 reactions found over 4 reactions in the full pathway
- 1.1.1.255-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
- MANNKIN-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-14500
- 0 associated gene:
- 1 reconstruction source(s) associated: