Difference between revisions of "PWY-401"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * common name:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-401 PWY-401] ==
−
* smiles:
+
* taxonomic range:
−
** CN1(C=NC2(NC(=O)NC(=O)C1=2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** 7-methylxanthine
+
** galactolipid biosynthesis I
−
* inchi key:
+
−
** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
+
−
* molecular weight:
+
−
** 166.139   
+
 
* Synonym(s):
 
* Synonym(s):
−
** heteroxanthine
+
** galactosylglyceride biosynthesis I
−
** 3,7-dihydro-7-methyl-1H-purine-2,6-dione
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-11521]]
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[2.4.1.46-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_4096]]
 +
*** [[Tiso_gene_9530]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-1225]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_2142]]
 +
*** [[Tiso_gene_106]]
 +
*** [[Tiso_gene_11479]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-1226]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2142]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-16635]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2142]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-9721]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2142]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* ARACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-401 PWY-401]
−
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://www.chemspider.com/Chemical-Structure.61660.html 61660]
+
{{#set: common name=galactolipid biosynthesis I}}
−
* HMDB : HMDB01991
+
{{#set: common name=galactosylglyceride biosynthesis I}}
−
* CHEBI:
+
{{#set: reaction found=5}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991]
+
{{#set: total reaction=5}}
−
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353]
+
−
{{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}}
+
−
{{#set: common name=7-methylxanthine}}
+
−
{{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=166.139    }}
+
−
{{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}}
+
−
{{#set: consumed by=RXN-11521}}
+

Latest revision as of 20:06, 21 March 2018

Pathway PWY-401

  • taxonomic range:
  • common name:
    • galactolipid biosynthesis I
  • Synonym(s):
    • galactosylglyceride biosynthesis I

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-401&oldid=39505"