Difference between revisions of "PWY-5076"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5076 PWY-5076] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5076 PWY-5076] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-leucine degradation III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** Ehrlich pathway | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[RXN- | + | * [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]] |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_18403]] | ||
| + | *** [[Tiso_gene_14984]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[annotation-experimental_annotation]] | ||
| + | *** [[manual-primary_network]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-7693]] | ||
| + | ** 5 associated gene(s): | ||
| + | *** [[Tiso_gene_6562]] | ||
| + | *** [[Tiso_gene_7649]] | ||
| + | *** [[Tiso_gene_5424]] | ||
| + | *** [[Tiso_gene_5425]] | ||
| + | *** [[Tiso_gene_6563]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-7692 RXN-7692] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=L-leucine degradation III}} | |
| − | {{#set: | + | {{#set: common name=Ehrlich pathway}} |
| − | {{#set: | + | {{#set: reaction found=2}} |
| − | {{#set: common name= | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=67.0}} |
| − | {{#set: | + | |
Latest revision as of 20:25, 21 March 2018
Pathway PWY-5076
- taxonomic range:
- common name:
- L-leucine degradation III
- Synonym(s):
- Ehrlich pathway
Reaction(s) found
2 reactions found over 3 reactions in the full pathway
- BRANCHED-CHAINAMINOTRANSFERLEU-RXN
- 2 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN-7693
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
