Difference between revisions of "PWY-5136"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5136 PWY-5136] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11398 CPD-11398] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5136 PWY-5136] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** L-thyroxine phenolic β-D-glucuronide
+
** fatty acid β-oxidation II (peroxisome)
−
* inchi key:
+
−
** InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M
+
−
* molecular weight:
+
−
** 951.992   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-thyroxine phenolic glucuronide
+
** fatty acid β-oxidation II (plants)
−
** thyroxine glucuronide
+
−
** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-
+
−
** T4G
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''5''' reactions in the full pathway
−
* [[RXN-10606]]
+
* [[ACYLCOASYN-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 9 associated gene(s):
 +
*** [[Tiso_gene_136]]
 +
*** [[Tiso_gene_7855]]
 +
*** [[Tiso_gene_9394]]
 +
*** [[Tiso_gene_10876]]
 +
*** [[Tiso_gene_4191]]
 +
*** [[Tiso_gene_13394]]
 +
*** [[Tiso_gene_500]]
 +
*** [[Tiso_gene_348]]
 +
*** [[Tiso_gene_135]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[ENOYL-COA-HYDRAT-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_16145]]
 +
*** [[Tiso_gene_6885]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[KETOACYLCOATHIOL-RXN]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_10116]]
 +
*** [[Tiso_gene_17451]]
 +
*** [[Tiso_gene_3856]]
 +
*** [[Tiso_gene_3855]]
 +
*** [[Tiso_gene_15327]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[OHACYL-COA-DEHYDROG-RXN]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_18838]]
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_14027]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-11026]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_18566]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* METACYC:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237176 44237176]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=PWY-5136 PWY-5136]
−
{{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=C(I)C(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}}
+
* ARACYC:
−
{{#set: common name=L-thyroxine phenolic β-D-glucuronide}}
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5136 PWY-5136]
−
{{#set: inchi key=InChIKey=RGHRJBIKIYUHEV-SGPDEFQSSA-M}}
+
{{#set: taxonomic range=TAX-33090}}
−
{{#set: molecular weight=951.992    }}
+
{{#set: common name=fatty acid β-oxidation II (peroxisome)}}
−
{{#set: common name=L-thyroxine phenolic glucuronide|thyroxine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2,6-diiodophenyl, (S)-|T4G}}
+
{{#set: common name=fatty acid β-oxidation II (plants)}}
−
{{#set: produced by=RXN-10606}}
+
{{#set: reaction found=5}}
 +
{{#set: total reaction=5}}
 +
{{#set: completion rate=100.0}}

Latest revision as of 20:50, 21 March 2018

Pathway PWY-5136

  • taxonomic range:
  • common name:
    • fatty acid β-oxidation II (peroxisome)
  • Synonym(s):
    • fatty acid β-oxidation II (plants)

Reaction(s) found

5 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5136&oldid=44054"