Difference between revisions of "PWY-5340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * smiles: ** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5340 PWY-5340] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5340 PWY-5340] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J
+
 
* common name:
 
* common name:
** (5Z)-tetradecenoyl-CoA
+
** sulfate activation for sulfonation
* molecular weight:
+
** 971.845   
+
 
* Synonym(s):
 
* Synonym(s):
** cis-tetradec-5-enoyl-CoA
+
** sulfation pathway
** 14:1 cis-5
+
** 14:1(n-9)
+
** (5Z)-tetradec-5-enoyl-CoA
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-14576]]
+
'''2''' reactions found over '''2''' reactions in the full pathway
* [[RXN-17783]]
+
* [[ADENYLYLSULFKIN-RXN]]
== Reaction(s) known to produce the compound ==
+
** 5 associated gene(s):
* [[RXN-17782]]
+
*** [[Tiso_gene_17879]]
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_1110]]
 +
*** [[Tiso_gene_9490]]
 +
*** [[Tiso_gene_16197]]
 +
*** [[Tiso_gene_17878]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_10254]]
 +
*** [[Tiso_gene_17879]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[manual-primary_network]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659071 90659071]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-5340 PWY-5340]
* CHEBI:
+
* ARACYC:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84650 84650]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5340 PWY-5340]
{{#set: smiles=CCCCCCCCC=CCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-2759}}
{{#set: inchi key=InChIKey=MRVDZOHJMLTLHJ-STFCKWFXSA-J}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: common name=(5Z)-tetradecenoyl-CoA}}
+
{{#set: common name=sulfate activation for sulfonation}}
{{#set: molecular weight=971.845    }}
+
{{#set: common name=sulfation pathway}}
{{#set: common name=cis-tetradec-5-enoyl-CoA|14:1 cis-5|14:1(n-9)|(5Z)-tetradec-5-enoyl-CoA}}
+
{{#set: reaction found=2}}
{{#set: consumed by=RXN-14576|RXN-17783}}
+
{{#set: total reaction=2}}
{{#set: produced by=RXN-17782}}
+
{{#set: completion rate=100.0}}

Latest revision as of 20:43, 21 March 2018

Pathway PWY-5340

  • taxonomic range:
  • common name:
    • sulfate activation for sulfonation
  • Synonym(s):
    • sulfation pathway

Reaction(s) found

2 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links