Difference between revisions of "PWY-5469"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] == * smiles: ** C(C(C(=O)[O-])=O)S * common name: ** 3...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5469 PWY-5469] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5469 PWY-5469] ==
* smiles:
+
* taxonomic range:
** C(C(C(=O)[O-])=O)S
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** 3-mercaptopyruvate
+
** sesamin biosynthesis
* inchi key:
+
** InChIKey=OJOLFAIGOXZBCI-UHFFFAOYSA-M
+
* molecular weight:
+
** 119.115   
+
 
* Synonym(s):
 
* Synonym(s):
** mercaptopyruvate
 
** 3-mercaptopyruvic acid
 
** β-thiopyruvate
 
** β-mercaptopyruvate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[MERCAPYSTRANS-RXN]]
+
'''1''' reactions found over '''8''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-17352]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
* [[CYSTEINE-AMINOTRANSFERASE-RXN]]
+
*** [[Tiso_gene_11016]]
 +
*** [[Tiso_gene_15820]]
 +
*** [[Tiso_gene_15962]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17351 RXN-17351]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8677 RXN-8677]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8695 RXN-8695]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8696 RXN-8696]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8703 RXN-8703]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8704 RXN-8704]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8705 RXN-8705]
 
== External links  ==
 
== External links  ==
* CAS : 2464-23-5
+
{{#set: taxonomic range=TAX-33090}}
* BIGG : mercppyr
+
{{#set: common name=sesamin biosynthesis}}
* PUBCHEM:
+
{{#set: reaction found=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4182595 4182595]
+
{{#set: total reaction=8}}
* HMDB : HMDB01368
+
{{#set: completion rate=13.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00957 C00957]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.3393581.html 3393581]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57678 57678]
+
* METABOLIGHTS : MTBLC57678
+
{{#set: smiles=C(C(C(=O)[O-])=O)S}}
+
{{#set: common name=3-mercaptopyruvate}}
+
{{#set: inchi key=InChIKey=OJOLFAIGOXZBCI-UHFFFAOYSA-M}}
+
{{#set: molecular weight=119.115    }}
+
{{#set: common name=mercaptopyruvate|3-mercaptopyruvic acid|β-thiopyruvate|β-mercaptopyruvate}}
+
{{#set: consumed by=MERCAPYSTRANS-RXN}}
+
{{#set: reversible reaction associated=CYSTEINE-AMINOTRANSFERASE-RXN}}
+

Latest revision as of 20:05, 21 March 2018

Pathway PWY-5469

  • taxonomic range:
  • common name:
    • sesamin biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links