Difference between revisions of "PWY-5690"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC=C(O)1) * common name...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690] ==
−
* smiles:
+
* taxonomic range:
−
** COC1(=CC(C=CC=O)=CC=C(O)1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** coniferaldehyde
+
** TCA cycle II (plants and fungi)
−
* inchi key:
+
−
** InChIKey=DKZBBWMURDFHNE-NSCUHMNNSA-N
+
−
* molecular weight:
+
−
** 178.187   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-hydroxy-3-methoxycinnamaldehyde
+
** TCA cycle -- aerobic respiration
−
** 4-hydroxy-3-methoxycinnamic aldehyde
+
** tricarboxylic acid cycle
−
** coniferyl aldehyde
+
** citric acid cycle
 +
** Szent-Gyorgyi-Krebs cycle
 +
** Krebs cycle
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''6''' reactions found over '''9''' reactions in the full pathway
−
* [[RXN-1106]]
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_13007]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[CITSYN-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18030]]
 +
*** [[Tiso_gene_9601]]
 +
*** [[Tiso_gene_9603]]
 +
*** [[Tiso_gene_9602]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_3691]]
 +
*** [[Tiso_gene_6720]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_2323]]
 +
*** [[Tiso_gene_1990]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15846]]
 +
*** [[Tiso_gene_11866]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=2OXOGLUTARATEDEH-RXN 2OXOGLUTARATEDEH-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=ISOCITRATE-DEHYDROGENASE-NAD+-RXN ISOCITRATE-DEHYDROGENASE-NAD+-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971]
 
== External links  ==
 
== External links  ==
−
* CAS : 458-36-6
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280536 5280536]
+
{{#set: common name=TCA cycle II (plants and fungi)}}
−
* LIGAND-CPD:
+
{{#set: common name=TCA cycle -- aerobic respiration|tricarboxylic acid cycle|citric acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02666 C02666]
+
{{#set: reaction found=6}}
−
* CHEMSPIDER:
+
{{#set: total reaction=9}}
−
** [http://www.chemspider.com/Chemical-Structure.4444167.html 4444167]
+
{{#set: completion rate=67.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16547 16547]
+
−
* METABOLIGHTS : MTBLC16547
+
−
{{#set: smiles=COC1(=CC(C=CC=O)=CC=C(O)1)}}
+
−
{{#set: common name=coniferaldehyde}}
+
−
{{#set: inchi key=InChIKey=DKZBBWMURDFHNE-NSCUHMNNSA-N}}
+
−
{{#set: molecular weight=178.187    }}
+
−
{{#set: common name=4-hydroxy-3-methoxycinnamaldehyde|4-hydroxy-3-methoxycinnamic aldehyde|coniferyl aldehyde}}
+
−
{{#set: produced by=RXN-1106}}
+

Latest revision as of 20:19, 21 March 2018

Pathway PWY-5690

  • taxonomic range:
  • common name:
    • TCA cycle II (plants and fungi)
  • Synonym(s):
    • TCA cycle -- aerobic respiration
    • tricarboxylic acid cycle
    • citric acid cycle
    • Szent-Gyorgyi-Krebs cycle
    • Krebs cycle

Reaction(s) found

6 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5690&oldid=40861"