Difference between revisions of "PWY-5690"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] == * smiles: ** COC1(=CC(C=CC=O)=CC=C(O)1) * common name...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5690 PWY-5690] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** TCA cycle II (plants and fungi) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** TCA cycle -- aerobic respiration |
− | ** | + | ** tricarboxylic acid cycle |
− | ** | + | ** citric acid cycle |
+ | ** Szent-Gyorgyi-Krebs cycle | ||
+ | ** Krebs cycle | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''6''' reactions found over '''9''' reactions in the full pathway | |
− | * [[RXN- | + | * [[ACONITATEDEHYDR-RXN]] |
− | == Reaction(s) | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_13007]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | * [[ACONITATEHYDR-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_13007]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | * [[CITSYN-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_18030]] | ||
+ | *** [[Tiso_gene_9601]] | ||
+ | *** [[Tiso_gene_9603]] | ||
+ | *** [[Tiso_gene_9602]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[FUMHYDR-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_3691]] | ||
+ | *** [[Tiso_gene_6720]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[MALATE-DEH-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_2323]] | ||
+ | *** [[Tiso_gene_1990]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[SUCCCOASYN-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_15846]] | ||
+ | *** [[Tiso_gene_11866]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2OXOGLUTARATEDEH-RXN 2OXOGLUTARATEDEH-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ISOCITRATE-DEHYDROGENASE-NAD+-RXN ISOCITRATE-DEHYDROGENASE-NAD+-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14971 RXN-14971] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=TCA cycle II (plants and fungi)}} | |
− | + | {{#set: common name=TCA cycle -- aerobic respiration|tricarboxylic acid cycle|citric acid cycle|Szent-Gyorgyi-Krebs cycle|Krebs cycle}} | |
− | + | {{#set: reaction found=6}} | |
− | + | {{#set: total reaction=9}} | |
− | + | {{#set: completion rate=67.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:19, 21 March 2018
Pathway PWY-5690
- taxonomic range:
- common name:
- TCA cycle II (plants and fungi)
- Synonym(s):
- TCA cycle -- aerobic respiration
- tricarboxylic acid cycle
- citric acid cycle
- Szent-Gyorgyi-Krebs cycle
- Krebs cycle
Reaction(s) found
6 reactions found over 9 reactions in the full pathway
- ACONITATEDEHYDR-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- ACONITATEHYDR-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- CITSYN-RXN
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- FUMHYDR-RXN
- 2 associated gene(s):
- 6 reconstruction source(s) associated:
- MALATE-DEH-RXN
- 2 associated gene(s):
- 7 reconstruction source(s) associated:
- SUCCCOASYN-RXN
- 2 associated gene(s):
- 7 reconstruction source(s) associated: