Difference between revisions of "PWY-6398"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] == * smiles: ** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12)) * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-77...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6398 PWY-6398] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-7742 TAX-7742] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** melatonin degradation I |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''5''' reactions found over '''5''' reactions in the full pathway | |
| + | * [[RXN-11056]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_1035]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-11057]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_1035]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-11058]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_5505]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
* [[RXN-11059]] | * [[RXN-11059]] | ||
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_5505]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[RXN-11060]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[Tiso_gene_14141]] | ||
| + | *** [[Tiso_gene_14140]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * LIGAND-MAP: |
| − | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?map00380 map00380] |
| − | + | {{#set: taxonomic range=TAX-7742}} | |
| − | {{#set: | + | {{#set: common name=melatonin degradation I}} |
| − | + | {{#set: reaction found=5}} | |
| − | {{#set: common name= | + | {{#set: total reaction=5}} |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:43, 21 March 2018
Pathway PWY-6398
- taxonomic range:
- common name:
- melatonin degradation I
- Synonym(s):
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- RXN-11056
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11057
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11058
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11059
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- RXN-11060
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- LIGAND-MAP:
