Difference between revisions of "PWY-6692"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * smiles: ** C(C1(=CC=CC=C1O))([O-])=O * inchi key: ** InChIKey=YGSDEFSMJLZ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6692 PWY-6692] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6692 PWY-6692] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Fe(II) oxidation |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** iron oxidation |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''6''' reactions in the full pathway | |
− | * [[ | + | * [[NADH-DEHYDROG-A-RXN]] |
− | * [[ | + | ** 18 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_13075]] |
+ | *** [[Tiso_gene_4836]] | ||
+ | *** [[Tiso_gene_5171]] | ||
+ | *** [[Tiso_gene_359]] | ||
+ | *** [[Tiso_gene_15276]] | ||
+ | *** [[Tiso_gene_10326]] | ||
+ | *** [[Tiso_gene_18831]] | ||
+ | *** [[Tiso_gene_4894]] | ||
+ | *** [[Tiso_gene_9874]] | ||
+ | *** [[Tiso_gene_18172]] | ||
+ | *** [[Tiso_gene_18339]] | ||
+ | *** [[Tiso_gene_19691]] | ||
+ | *** [[Tiso_gene_2949]] | ||
+ | *** [[Tiso_gene_17199]] | ||
+ | *** [[Tiso_gene_18707]] | ||
+ | *** [[Tiso_gene_3113]] | ||
+ | *** [[Tiso_gene_355]] | ||
+ | *** [[Tiso_gene_358]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-15829]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_7235]] | ||
+ | *** [[Tiso_gene_9627]] | ||
+ | *** [[Tiso_gene_4973]] | ||
+ | *** [[Tiso_gene_18330]] | ||
+ | *** [[Tiso_gene_15926]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-15830]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_15682]] | ||
+ | *** [[Tiso_gene_18053]] | ||
+ | *** [[Tiso_gene_18580]] | ||
+ | *** [[Tiso_gene_7948]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12075 RXN-12075] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12076 RXN-12076] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-15832 RXN-15832] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=Fe(II) oxidation}} | |
− | + | {{#set: common name=iron oxidation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:33, 21 March 2018
Pathway PWY-6692
- taxonomic range:
- common name:
- Fe(II) oxidation
- Synonym(s):
- iron oxidation
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- NADH-DEHYDROG-A-RXN
- 18 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-15829
- 5 associated gene(s):
- 3 reconstruction source(s) associated:
- RXN-15830
- 4 associated gene(s):
- 3 reconstruction source(s) associated: