Difference between revisions of "PWY-6859"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] == * smiles: ** CCCCCC=CCC(O)C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=6Z8E10E14Z-5S12R-512-DIHYDROXYI 6Z8E10E14Z-5S12R-512-DIHYDROXYI] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859] ==
* smiles:
+
* taxonomic range:
** CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 
* common name:
 
* common name:
** leukotriene B4
+
** all-trans-farnesol biosynthesis
* inchi key:
+
** InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M
+
* molecular weight:
+
** 335.462   
+
 
* Synonym(s):
 
* Synonym(s):
** (6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate
+
** trans,trans-farnesol biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''4''' reactions in the full pathway
* [[LEUKOTRIENE-A4-HYDROLASE-RXN]]
+
* [[FPPSYN-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Tiso_gene_16284]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[manual-primary_network]]
 +
* [[GPPSYN-RXN]]
 +
** 9 associated gene(s):
 +
*** [[Tiso_gene_19542]]
 +
*** [[Tiso_gene_18201]]
 +
*** [[Tiso_gene_16284]]
 +
*** [[Tiso_gene_2848]]
 +
*** [[Tiso_gene_1035]]
 +
*** [[Tiso_gene_4719]]
 +
*** [[Tiso_gene_11582]]
 +
*** [[Tiso_gene_13582]]
 +
*** [[Tiso_gene_10317]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[manual-primary_network]]
 +
* [[IPPISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8653]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8617 RXN-8617]
 
== External links  ==
 
== External links  ==
* CAS : 71160-24-2
+
{{#set: taxonomic range=TAX-2759}}
* PUBCHEM:
+
{{#set: common name=all-trans-farnesol biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615214 23615214]
+
{{#set: common name=trans,trans-farnesol biosynthesis}}
* HMDB : HMDB01085
+
{{#set: reaction found=3}}
* LIGAND-CPD:
+
{{#set: total reaction=4}}
** [http://www.genome.jp/dbget-bin/www_bget?C02165 C02165]
+
{{#set: completion rate=75.0}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57461 57461]
+
* METABOLIGHTS : MTBLC57461
+
{{#set: smiles=CCCCCC=CCC(O)C=CC=CC=CC(O)CCCC(=O)[O-]}}
+
{{#set: common name=leukotriene B4}}
+
{{#set: inchi key=InChIKey=VNYSSYRCGWBHLG-AMOLWHMGSA-M}}
+
{{#set: molecular weight=335.462    }}
+
{{#set: common name=(6z,8e,10e,14z)-(5s,12r)-5,12-dihydroxyicosa-6,8,10,14-tetraenoate}}
+
{{#set: produced by=LEUKOTRIENE-A4-HYDROLASE-RXN}}
+

Latest revision as of 20:22, 21 March 2018

Pathway PWY-6859

  • taxonomic range:
  • common name:
    • all-trans-farnesol biosynthesis
  • Synonym(s):
    • trans,trans-farnesol biosynthesis

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links