Difference between revisions of "PWY-6908"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10277 CPD-10277] == * smiles: ** CCC(OC1(OC(CO)C(O)C(O)C(O)1))(C#N)C * common name: ** lota...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33630 TAX-33630] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* common name: | * common name: | ||
− | ** | + | ** thiamine diphosphate biosynthesis IV (eukaryotes) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** thiamin diphosphate biosynthesis IV (eukaryotes) |
+ | ** vitamin B1 biosynthesis IV (eukaryotes) | ||
+ | ** thiamine diphosphate biosynthesis (plants) | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[RXNQT-4191]] | |
− | * [[RXN- | + | ** 5 associated gene(s): |
− | == Reaction(s) | + | *** [[Tiso_gene_4497]] |
+ | *** [[Tiso_gene_15256]] | ||
+ | *** [[Tiso_gene_17625]] | ||
+ | *** [[Tiso_gene_11838]] | ||
+ | *** [[Tiso_gene_17610]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[THI-P-SYN-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_10320]] | ||
+ | *** [[Tiso_gene_2159]] | ||
+ | *** [[Tiso_gene_2160]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_16512]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: taxonomic range=TAX-33630}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=thiamine diphosphate biosynthesis IV (eukaryotes)}} | |
− | + | {{#set: common name=thiamin diphosphate biosynthesis IV (eukaryotes)|vitamin B1 biosynthesis IV (eukaryotes)|thiamine diphosphate biosynthesis (plants)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | {{#set: | + | {{#set: completion rate=100.0}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:49, 21 March 2018
Pathway PWY-6908
- taxonomic range:
- common name:
- thiamine diphosphate biosynthesis IV (eukaryotes)
- Synonym(s):
- thiamin diphosphate biosynthesis IV (eukaryotes)
- vitamin B1 biosynthesis IV (eukaryotes)
- thiamine diphosphate biosynthesis (plants)
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- RXNQT-4191
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- THI-P-SYN-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- THIAMIN-PYROPHOSPHOKINASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated: