Difference between revisions of "PWY-7050"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6588 PWY-6588] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * smiles: ** CC(C(SC(CCCCC(N)=O)CCS)=O)C * common name: ** S-(2-methylpropa...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C(SC(CCCCC(N)=O)CCS)=O)C |
* common name: | * common name: | ||
− | ** | + | ** S-(2-methylpropanoyl)-dihydrolipoamide |
+ | * inchi key: | ||
+ | ** InChIKey=XZUKURPVWDTXGE-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 277.439 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** S-(2-methylpropionyl)-dihydrolipoamide |
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[DHRT_ibcoa]] | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440335 440335] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.389302.html 389302] |
− | {{#set: | + | {{#set: smiles=CC(C(SC(CCCCC(N)=O)CCS)=O)C}} |
− | {{#set: | + | {{#set: common name=S-(2-methylpropanoyl)-dihydrolipoamide}} |
+ | {{#set: inchi key=InChIKey=XZUKURPVWDTXGE-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=277.439 }} | ||
+ | {{#set: common name=S-(2-methylpropionyl)-dihydrolipoamide}} | ||
+ | {{#set: consumed by=DHRT_ibcoa}} |
Revision as of 16:29, 21 March 2018
Contents
Metabolite CPD-281
- smiles:
- CC(C(SC(CCCCC(N)=O)CCS)=O)C
- common name:
- S-(2-methylpropanoyl)-dihydrolipoamide
- inchi key:
- InChIKey=XZUKURPVWDTXGE-UHFFFAOYSA-N
- molecular weight:
- 277.439
- Synonym(s):
- S-(2-methylpropionyl)-dihydrolipoamide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links