Difference between revisions of "PWY-7197"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10821 RXN-10821] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == * smiles: ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19151 CPD-19151] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J |
+ | * common name: | ||
+ | ** (S)-3-hydroxy-(5Z)-dodecenoyl-CoA | ||
+ | * molecular weight: | ||
+ | ** 959.791 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** (S)-3-hydroxy-12:1-Δ5-CoA | ||
+ | ** (S)-3-hydroxy-5-cis-dodecenoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-17798]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17797]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: smiles=CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: inchi key=InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J}} | |
− | + | {{#set: common name=(S)-3-hydroxy-(5Z)-dodecenoyl-CoA}} | |
− | + | {{#set: molecular weight=959.791 }} | |
− | {{#set: | + | {{#set: common name=(S)-3-hydroxy-12:1-Δ5-CoA|(S)-3-hydroxy-5-cis-dodecenoyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-17798}} |
− | {{#set: | + | {{#set: produced by=RXN-17797}} |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:28, 18 March 2018
Contents
Metabolite CPD-19151
- smiles:
- CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=AYORDFMYYBNSBO-QCCSJADRSA-J
- common name:
- (S)-3-hydroxy-(5Z)-dodecenoyl-CoA
- molecular weight:
- 959.791
- Synonym(s):
- (S)-3-hydroxy-12:1-Δ5-CoA
- (S)-3-hydroxy-5-cis-dodecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.