Difference between revisions of "PWY-7274"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7274 PWY-7274] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-20...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7274 PWY-7274] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2062 TAX-2062] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** D-cycloserine biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | * [[SERINE-O-ACETTRAN-RXN]] |
− | * [[ | + | ** 3 associated gene(s): |
− | + | *** [[Tiso_gene_7066]] | |
− | * [[ | + | *** [[Tiso_gene_10634]] |
− | * [[ | + | *** [[Tiso_gene_4492]] |
− | * [[ | + | ** 6 reconstruction source(s) associated: |
− | * [[ | + | *** [[orthology-esiliculosus]] |
− | * [[ | + | *** [[annotation-in-silico_annotation]] |
− | * [[ | + | *** [[orthology-athaliana]] |
− | == Reaction(s) | + | *** [[orthology-synechocystis]] |
− | * [[ | + | *** [[manual-primary_network]] |
− | * [ | + | *** [[orthology-creinhardtii]] |
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12537 RXN-12537] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14457 RXN-14457] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14458 RXN-14458] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14459 RXN-14459] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-14460 RXN-14460] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2062}} | |
− | + | {{#set: common name=D-cycloserine biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=17.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:20, 21 March 2018
Pathway PWY-7274
- taxonomic range:
- common name:
- D-cycloserine biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 6 reactions in the full pathway
- SERINE-O-ACETTRAN-RXN
- 3 associated gene(s):
- 6 reconstruction source(s) associated: