Difference between revisions of "PWY-7384"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * smiles: ** C1(N=CC=NC=1C(=O)N) * inchi key: ** InChIKey=IPEHBUM...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5970 PWY-5970] ==
−
* smiles:
+
* taxonomic range:
−
** C1(N=CC=NC=1C(=O)N)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
* inchi key:
+
−
** InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** pyrazinamide
+
** fatty acids biosynthesis (yeast)
−
* molecular weight:
+
−
** 123.114   
+
 
* Synonym(s):
 
* Synonym(s):
−
** pyrazinecarboxamide
+
** type I fatty acids biosynthesis
−
** pyrazinoic acid amide
+
−
** pyrazine carboxylamide
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[PYRAZIN-RXN]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[FATTY-ACYL-COA-SYNTHASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''0''' reaction(s) not found
 
== External links  ==
 
== External links  ==
−
* NCI:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=14911 14911]
+
{{#set: common name=fatty acids biosynthesis (yeast)}}
−
* DRUGBANK : DB00339
+
{{#set: common name=type I fatty acids biosynthesis}}
−
* PUBCHEM:
+
{{#set: reaction found=1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1046 1046]
+
{{#set: reaction not found=0}}
−
* HMDB : HMDB14483
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01956 C01956]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1017.html 1017]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45285 45285]
+
−
{{#set: smiles=C1(N=CC=NC=1C(=O)N)}}
+
−
{{#set: inchi key=InChIKey=IPEHBUMCGVEMRF-UHFFFAOYSA-N}}
+
−
{{#set: common name=pyrazinamide}}
+
−
{{#set: molecular weight=123.114    }}
+
−
{{#set: common name=pyrazinecarboxamide|pyrazinoic acid amide|pyrazine carboxylamide}}
+
−
{{#set: consumed by=PYRAZIN-RXN}}
+

Revision as of 16:43, 10 January 2018

Pathway PWY-5970

  • taxonomic range:
  • common name:
    • fatty acids biosynthesis (yeast)
  • Synonym(s):
    • type I fatty acids biosynthesis

Reaction(s) found

Reaction(s) not found

  • 0 reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7384&oldid=10167"