Difference between revisions of "PWY-7411"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M |
* common name: | * common name: | ||
| − | ** | + | ** phytenate |
| + | * molecular weight: | ||
| + | ** 309.511 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2E-phytenate | ||
| + | ** 2E-phytenic acid | ||
| + | ** 3,7,11,15-tetramethyl-2E-hexadecenoic acid | ||
| + | ** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN66-480]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN66-479]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | == Reaction(s) | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMPR0104010024 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755] |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}} |
| + | {{#set: common name=phytenate}} | ||
| + | {{#set: molecular weight=309.511 }} | ||
| + | {{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}} | ||
| + | {{#set: consumed by=RXN66-480}} | ||
| + | {{#set: produced by=RXN66-479}} | ||
Revision as of 19:13, 18 March 2018
Contents
Metabolite CPD-14927
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
- inchi key:
- InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
- common name:
- phytenate
- molecular weight:
- 309.511
- Synonym(s):
- 2E-phytenate
- 2E-phytenic acid
- 3,7,11,15-tetramethyl-2E-hexadecenoic acid
- (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-" cannot be used as a page name in this wiki.
