Difference between revisions of "PWY-7411"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...")
(Created page with "Category:Gene == Gene Tiso_gene_7561 == * right end position: ** 11030 * transcription direction: ** POSITIVE * left end position: ** 1767 * centisome position: ** 16.0170...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
+
== Gene Tiso_gene_7561 ==
−
* smiles:
+
* right end position:
−
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
+
** 11030
−
* inchi key:
+
* transcription direction:
−
** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** phytenate
+
** 1767
−
* molecular weight:
+
* centisome position:
−
** 309.511    
+
** 16.01704    
 
* Synonym(s):
 
* Synonym(s):
−
** 2E-phytenate
 
−
** 2E-phytenic acid
 
−
** 3,7,11,15-tetramethyl-2E-hexadecenoic acid
 
−
** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN66-480]]
+
* Reaction: [[3.1.4.11-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN66-479]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-13334]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16261]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6367]]
 +
* [[PWY-6351]]
 +
* [[PWY-7039]]
 +
* [[LIPASYN-PWY]]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104010024
+
{{#set: right end position=11030}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589]
+
{{#set: left end position=1767}}
−
* CHEMSPIDER:
+
{{#set: centisome position=16.01704   }}
−
** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755]
+
{{#set: reaction associated=3.1.4.11-RXN|RXN-13334|RXN-16261}}
−
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}}
+
{{#set: pathway associated=PWY-6367|PWY-6351|PWY-7039|LIPASYN-PWY}}
−
{{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}}
+
−
{{#set: common name=phytenate}}
+
−
{{#set: molecular weight=309.511   }}
+
−
{{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}}
+
−
{{#set: consumed by=RXN66-480}}
+
−
{{#set: produced by=RXN66-479}}
+

Revision as of 16:05, 21 March 2018

Gene Tiso_gene_7561

  • right end position:
    • 11030
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1767
  • centisome position:
    • 16.01704
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7411&oldid=32281"